CymitQuimica logo

CAS 1026598-63-9

:

2-Bromo-4-isopropylthiazol

Description:
2-Bromo-4-isopropylthiazole is a heterocyclic organic compound characterized by the presence of a thiazole ring, which is a five-membered ring containing both sulfur and nitrogen atoms. The compound features a bromine atom at the 2-position and an isopropyl group at the 4-position of the thiazole ring, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the bromine atom enhances its reactivity, making it useful in various chemical synthesis applications, including medicinal chemistry and agrochemicals. The isopropyl group provides steric hindrance, which can influence the compound's reactivity and interactions with biological targets. 2-Bromo-4-isopropylthiazole may exhibit biological activity, making it of interest in pharmaceutical research. As with many halogenated compounds, it is important to handle it with care due to potential toxicity and environmental impact. Proper safety measures should be observed when working with this substance in laboratory settings.
Formula:C6H8BrNS
InChI:InChI=1S/C6H8BrNS/c1-4(2)5-3-9-6(7)8-5/h3-4H,1-2H3
InChI key:DIIPUVSYKDLNDN-UHFFFAOYSA-N
SMILES:CC(C)C1=CSC(=N1)Br
Found 2 products.