CAS 102676-31-3
:Benzonitrile, 4-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-5-yl)-, hydrochloride (1:1)
Description:
Benzonitrile, 4-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-5-yl)-, hydrochloride (1:1), with CAS number 102676-31-3, is a chemical compound characterized by its unique structure that combines a benzonitrile moiety with a tetrahydroimidazo[1,5-a]pyridine group. This compound typically appears as a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the presence of the hydrochloride salt form. It exhibits properties associated with both aromatic and heterocyclic compounds, which may contribute to its potential biological activity. The presence of the imidazo[1,5-a]pyridine structure suggests possible applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. Additionally, the hydrochloride form enhances its stability and solubility, making it suitable for various chemical and biological applications. As with many organic compounds, handling should be done with care, following appropriate safety protocols to mitigate any potential hazards.
Formula:C14H13N3·ClH
InChI:InChI=1S/C14H13N3.ClH/c15-8-11-4-6-12(7-5-11)14-3-1-2-13-9-16-10-17(13)14;/h4-7,9-10,14H,1-3H2;1H
InChI key:InChIKey=UKCVAQGKEOJTSR-UHFFFAOYSA-N
SMILES:C(#N)C1=CC=C(C2N3C(CCC2)=CN=C3)C=C1.Cl
Synonyms:- 4-(5,6,7,8-Tetrahydroimidazo(1,5-a)pyridin-5-yl)benzonitrile monohydrochloride
- 4-(5,6,7,8-Tetrahydroimidazo[1,5-A]Pyridin-5-Yl)Benzonitrile Hydrochloride (1:1)
- Afema
- Benzonitrile, 4-(5,6,7,8-tetrahydroimidazo(1,5-a)pyridin-5-yl)-, monohydrochloride
- Benzonitrile, 4-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-5-yl)-, hydrochloride (1:1)
- Ccris 4597
- Cgs 16949
- Cgs 16949A
- Fadrozole HCl
- Fadrozole hydrochloride [USAN]
- Imidazo[1,5-a]pyridine, benzonitrile deriv.
- Fadrozole hydrochloride
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Benzonitrile, 4-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-5-yl)-, hydrochloride (1:1)
CAS:Formula:C14H14ClN3Purity:98%Color and Shape:SolidMolecular weight:259.73414-(5,6,7,8-Tetrahydroimidazo[1,5-A]Pyridin-5-Yl)Benzonitrile Hydrochloride
CAS:4-(5,6,7,8-Tetrahydroimidazo[1,5-A]Pyridin-5-Yl)Benzonitrile HydrochlorideFormula:C14H14ClN3Purity:98%Molecular weight:259.73Fadrozole hydrochloride
CAS:Fadrozole hydrochlorideFormula:C14H14ClN3Purity:≥95%Molecular weight:259.73Fadrozole hydrochloride
CAS:Fadrozole hydrochloride (CGS 16949A) is a model aromatase inhibitor that has been shown to suppress estrogen production in the ovaries of fish.Formula:C14H14ClN3Purity:99.55%Color and Shape:White SolidMolecular weight:259.73Fadrozole Hydrochloride
CAS:Applications Fadrozole hydrochloride is a very potent and selective inhibitory effect of the aromatase enzyme system.
Formula:C14H13N3·HClColor and Shape:NeatMolecular weight:223.27 + (36.46)Fadrozole hydrochloride
CAS:Selective, non-steroidal aromatase inhibitor; used in breast cancerFormula:C14H13N3·HClPurity:Min. 95%Molecular weight:259.73 g/mol






