CymitQuimica logo

CAS 10268-61-8

:

Benzoic acid, 2-hydroxy-, 4-methoxyphenyl ester

Description:
Benzoic acid, 2-hydroxy-, 4-methoxyphenyl ester, commonly known as methyl salicylate, is an organic compound characterized by its ester functional group. It is derived from salicylic acid and methanol, featuring a methoxy group (-OCH3) and a hydroxyl group (-OH) on the aromatic ring. This compound typically appears as a colorless to pale yellow liquid with a characteristic sweet, minty odor. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water. Methyl salicylate is known for its use in flavoring, fragrance, and as a topical analgesic in medicinal formulations. Additionally, it exhibits anti-inflammatory and analgesic properties, making it a common ingredient in muscle rubs and ointments. The compound's structure contributes to its reactivity, allowing it to participate in various chemical reactions, including esterification and hydrolysis. Safety considerations include potential skin irritation and toxicity if ingested in large amounts, necessitating careful handling and usage.
Formula:C14H12O4
InChI:InChI=1S/C14H12O4/c1-17-10-6-8-11(9-7-10)18-14(16)12-4-2-3-5-13(12)15/h2-9,15H,1H3
InChI key:LOGPCYCUQVVEIF-UHFFFAOYSA-N
SMILES:COC1=CC=C(C=C1)OC(=O)C2=CC=CC=C2O
Found 1 products.