CAS 102682-81-5
:1-Propene, 1,2,3,3,3-pentafluoro-1-iodo-, (Z)-
Description:
1-Propene, 1,2,3,3,3-pentafluoro-1-iodo-, (Z)- is a fluorinated organic compound characterized by its unique structure, which includes a propene backbone with multiple fluorine and iodine substituents. The presence of five fluorine atoms significantly influences its physical and chemical properties, imparting high stability and low reactivity typical of perfluorinated compounds. The (Z)- configuration indicates that the highest priority substituents on the double bond are on the same side, affecting its stereochemistry and potentially its reactivity. This compound is likely to be a colorless gas or liquid at room temperature, exhibiting low volatility and high density. Its fluorinated nature suggests it may have applications in specialized fields such as pharmaceuticals, agrochemicals, or materials science, particularly in contexts where chemical stability and resistance to degradation are essential. Additionally, the iodine atom may introduce unique reactivity patterns, making it a candidate for further chemical transformations. Safety considerations are paramount due to the potential environmental impact of fluorinated compounds.
Formula:C3F5I
InChI:InChI=1S/C3F5I/c4-1(2(5)9)3(6,7)8/b2-1-
InChI key:RMHNIOZYXWTWOP-UPHRSURJSA-N
SMILES:C(=C(\F)/I)(\C(F)(F)F)/F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.


