CymitQuimica logo

CAS 102714-93-2

:

2-Fluoro-4,4′-bis(trans-4-propylcyclohexyl)-1,1′-biphenyl

Description:
2-Fluoro-4,4′-bis(trans-4-propylcyclohexyl)-1,1′-biphenyl, with the CAS number 102714-93-2, is a specialized organic compound notable for its unique structural features and potential applications in materials science, particularly in liquid crystal technologies. This compound contains a biphenyl core substituted with a fluorine atom and two trans-4-propylcyclohexyl groups, which contribute to its distinct physical and chemical properties. The presence of the fluorine atom can enhance the compound's thermal stability and influence its electronic characteristics, while the bulky cyclohexyl groups may affect its solubility and phase behavior. Typically, such compounds exhibit liquid crystalline behavior, making them valuable in the development of advanced display technologies. Additionally, the stereochemistry of the substituents plays a crucial role in determining the compound's overall molecular conformation and interactions with other materials. Overall, 2-Fluoro-4,4′-bis(trans-4-propylcyclohexyl)-1,1′-biphenyl represents a significant class of compounds in the field of organic electronics and liquid crystal research.
Formula:C30H41F
InChI:InChI=1/C30H41F/c1-3-5-22-7-11-24(12-8-22)25-15-17-27(18-16-25)29-20-19-28(21-30(29)31)26-13-9-23(6-4-2)10-14-26/h15-24,26H,3-14H2,1-2H3/t22-,23-,24-,26-
InChI key:InChIKey=SRJLZDPWUSOULH-LWPGTKICNA-N
SMILES:FC1=C(C2=CC=C(C=C2)[C@H]3CC[C@H](CCC)CC3)C=CC(=C1)[C@H]4CC[C@H](CCC)CC4
Synonyms:
  • 1,1′-Biphenyl, 2-fluoro-4,4′-bis(trans-4-propylcyclohexyl)-
  • 4,4′-Bis(trans-4-propylcyclohexyl)-2-fluorobiphenyl
  • 2-Fluoro-4,4′-bis(trans-4-propylcyclohexyl)-1,1′-biphenyl
  • 4-(trans-4-Propylcyclohexyl)-2-fluoro-4′-(trans-4-propylcyclohexyl)biphenyl
  • 1,1′-Biphenyl, 2-fluoro-4,4′-bis(4-propylcyclohexyl)-, [trans(trans)]-
Found 5 products.