CymitQuimica logo

CAS 1027159-01-8

:

3H-IMidazo[4,5-b]pyridine-3-carboxylic acid, 1,2-dihydro-2-oxo-, 1,1-diMethylethyl ester

Description:
3H-Imidazo[4,5-b]pyridine-3-carboxylic acid, 1,2-dihydro-2-oxo-, 1,1-dimethylethyl ester is a chemical compound characterized by its imidazo-pyridine structure, which is a bicyclic heterocyclic compound featuring nitrogen atoms in its rings. This compound typically exhibits properties associated with both carboxylic acids and esters, including potential acidity and reactivity due to the carboxyl functional group. The presence of the dimethyl group suggests steric hindrance, which may influence its reactivity and solubility. It is likely to be a solid at room temperature, with moderate to high polarity due to the functional groups present. The compound may also exhibit biological activity, making it of interest in pharmaceutical research. Its CAS number, 1027159-01-8, allows for precise identification in chemical databases. As with many heterocycles, it may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, depending on the conditions and the presence of other reactants.
Formula:C11H13N3O3
InChI:InChI=1S/C11H13N3O3/c1-11(2,3)17-10(16)14-8-7(13-9(14)15)5-4-6-12-8/h4-6H,1-3H3,(H,13,15)
InChI key:OYIYQMHHTPPHAT-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1C2=C(C=CC=N2)NC1=O
Found 3 products.