CymitQuimica logo

CAS 10272-50-1

:

1-methyl-4-phenylpiperidine hydrochloride (1:1)

Description:
1-Methyl-4-phenylpiperidine hydrochloride, with the CAS number 10272-50-1, is a chemical compound that belongs to the class of piperidine derivatives. It is characterized by a piperidine ring substituted with a methyl group at the nitrogen atom and a phenyl group at the 4-position. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and makes it suitable for various applications in research and pharmaceuticals. The substance exhibits psychoactive properties and has been studied for its potential effects on the central nervous system, particularly in relation to dopamine receptor activity. Its molecular structure contributes to its ability to interact with biological systems, making it of interest in medicinal chemistry. Safety data indicates that, like many piperidine derivatives, it should be handled with care due to potential toxicity and the need for appropriate safety measures in laboratory settings.
Formula:C12H18ClN
InChI:InChI=1/C12H17N.ClH/c1-13-9-7-12(8-10-13)11-5-3-2-4-6-11;/h2-6,12H,7-10H2,1H3;1H
SMILES:CN1CCC(CC1)c1ccccc1.Cl
Synonyms:
  • Piperidine, 1-Methyl-4-Phenyl-, Hydrochloride (1:1)
Found 2 products.