CymitQuimica logo

CAS 1027338-34-6

:

tert-Butyl(1-(aminomethyl)cyclopropyl)carbamate

Description:
Tert-Butyl(1-(aminomethyl)cyclopropyl)carbamate is a chemical compound characterized by its unique structure, which includes a tert-butyl group, a cyclopropyl ring, and an aminomethyl substituent. This compound belongs to the class of carbamates, which are esters or salts of carbamic acid. Its molecular structure contributes to its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the cyclopropyl moiety can impart distinctive steric and electronic properties, influencing the compound's reactivity and biological activity. Additionally, the tert-butyl group enhances lipophilicity, which may affect the compound's solubility and permeability in biological systems. The amino group can participate in hydrogen bonding, potentially enhancing interactions with biological targets. Overall, tert-Butyl(1-(aminomethyl)cyclopropyl)carbamate exhibits a combination of structural features that may be leveraged in various chemical and biological applications, although specific properties such as melting point, boiling point, and solubility would require empirical measurement or detailed literature references for precise characterization.
Formula:C9H18N2O2
InChI:InChI=1S/C9H18N2O2/c1-8(2,3)13-7(12)11-9(6-10)4-5-9/h4-6,10H2,1-3H3,(H,11,12)
InChI key:RPSISDKVKZYNRL-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)NC1(CC1)CN
Found 4 products.