CymitQuimica logo

CAS 1027511-74-5

:

1-benzyl-3-(tert-butoxycarbonylamino)pyrrolidine-3-carboxylic acid

Description:
1-Benzyl-3-(tert-butoxycarbonylamino)pyrrolidine-3-carboxylic acid is a chemical compound that features a pyrrolidine ring, which is a five-membered cyclic amine. This compound is characterized by the presence of a benzyl group, a tert-butoxycarbonyl (Boc) protecting group, and a carboxylic acid functional group. The Boc group is commonly used in organic synthesis to protect amines during chemical reactions, allowing for selective functionalization. The structure suggests that this compound may exhibit properties typical of amino acids, including potential solubility in polar solvents due to the carboxylic acid group. Additionally, the presence of the benzyl group may contribute to hydrophobic interactions, influencing its overall solubility and reactivity. The compound may also have applications in medicinal chemistry, particularly in the design of peptide-based drugs or as an intermediate in the synthesis of more complex molecules. Its specific reactivity and interactions would depend on the surrounding conditions and the presence of other functional groups in a given reaction context.
Formula:C17H24N2O4
InChI:InChI=1S/C17H24N2O4/c1-16(2,3)23-15(22)18-17(14(20)21)9-10-19(12-17)11-13-7-5-4-6-8-13/h4-8H,9-12H2,1-3H3,(H,18,22)(H,20,21)
InChI key:PXFJWKWTINVBAL-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)NC1(CCN(C1)CC2=CC=CC=C2)C(=O)O
Found 3 products.