CymitQuimica logo

CAS 1027514-11-9

:

Ethyl-2,2-difluoro-2-(4-n-butylphenyl)acetate

Description:
Ethyl-2,2-difluoro-2-(4-n-butylphenyl)acetate is an organic compound characterized by its ester functional group, which is formed from the reaction of an alcohol and a carboxylic acid. This compound features a difluorinated carbon center, indicating the presence of two fluorine atoms attached to the same carbon, which can significantly influence its chemical reactivity and physical properties. The presence of the n-butylphenyl group contributes to its hydrophobic characteristics, potentially affecting its solubility in various solvents. The compound is likely to exhibit moderate volatility and may have distinct odor characteristics typical of esters. Its fluorinated structure may impart unique properties such as increased stability and altered reactivity compared to non-fluorinated analogs. Ethyl-2,2-difluoro-2-(4-n-butylphenyl)acetate may find applications in fields such as pharmaceuticals, agrochemicals, or materials science, where specific chemical properties are desired. Safety data and handling precautions should be consulted, as fluorinated compounds can pose unique health and environmental risks.
Formula:C14H18F2O2
InChI:InChI=1S/C14H18F2O2/c1-3-5-6-11-7-9-12(10-8-11)14(15,16)13(17)18-4-2/h7-10H,3-6H2,1-2H3
InChI key:FEEVNRHGNOPKOM-UHFFFAOYSA-N
SMILES:CCCCC1=CC=C(C=C1)C(C(=O)OCC)(F)F
Synonyms:
  • Benzeneacetic acid, 4-butyl-α,α-difluoro-, ethyl ester
  • Ethyl 4-butyl-α,α-difluorobenzeneacetate
  • Ethyl-2,2-difluoro-2-(4-n-butylphenyl)acetate
  • Ethyl 2-(4-butylphenyl)-2,2-difluoroacetate
Found 3 products.