CymitQuimica logo

CAS 102791-46-8

:

2(1H)-Quinolinone, 6-(1H-pyrazol-1-yl)-

Description:
2(1H)-Quinolinone, 6-(1H-pyrazol-1-yl)- is a heterocyclic organic compound characterized by the presence of both quinolinone and pyrazole moieties. The quinolinone structure contributes to its aromaticity and potential biological activity, while the pyrazole ring enhances its reactivity and may influence its pharmacological properties. This compound typically exhibits a solid state at room temperature and is soluble in various organic solvents, which is common for many heterocycles. Its molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. The presence of nitrogen atoms in both rings can facilitate hydrogen bonding and coordination with metal ions, which may be relevant in catalysis or drug design. Additionally, compounds of this type may exhibit fluorescence or other optical properties, depending on their specific substituents and structural configuration. Overall, 2(1H)-Quinolinone, 6-(1H-pyrazol-1-yl)- is a versatile compound with potential applications in pharmaceuticals and materials science.
Formula:C12H9N3O
InChI:InChI=1S/C12H9N3O/c16-12-5-2-9-8-10(3-4-11(9)14-12)15-7-1-6-13-15/h1-8H,(H,14,16)
InChI key:HFGKTRGWPPAWOL-UHFFFAOYSA-N
SMILES:C1=CN(N=C1)C2=CC3=C(C=C2)NC(=O)C=C3
Found 3 products.