CAS 102831-44-7
:DIETHYL (BOC-AMINO)MALONATE
Description:
Diethyl (Boc-amino)malonate, with the CAS number 102831-44-7, is an organic compound that features a diethyl malonate backbone modified with a tert-butyloxycarbonyl (Boc) protecting group on an amino functional group. This compound is typically characterized by its molecular structure, which includes two ethyl ester groups and a malonate moiety, making it a versatile intermediate in organic synthesis, particularly in the preparation of amino acids and other nitrogen-containing compounds. The Boc group serves as a protective group for the amine, allowing for selective reactions without affecting the amino functionality. Diethyl (Boc-amino)malonate is generally a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents such as ethanol and dichloromethane but has limited solubility in water. The compound is often used in pharmaceutical and agrochemical research due to its ability to facilitate the formation of complex molecules through various synthetic pathways, including condensation and coupling reactions. Proper handling and storage are essential, as with many organic compounds, to ensure safety and stability.
Formula:C12H21NO6
InChI:InChI=1/C12H21NO6/c1-6-17-9(14)8(10(15)18-7-2)13-11(16)19-12(3,4)5/h8H,6-7H2,1-5H3,(H,13,16)
SMILES:CCOC(=O)C(C(=O)OCC)N=C(O)OC(C)(C)C
Synonyms:- Diethyl 2-[(Tert-Butoxycarbonyl)Amino]Malonate
- Diethyl 2-[N-(Tert-Butoxycarbonyl)Amino]Malonate
- Labotest-Bb Lt00452467
- (Boc-Amino)Malonic Acid Diethyl Ester
- (Boc-amino)malonic acid diethyl ester, Diethyl 2-[N-(tert-butoxycarbonyl)amino]malonate
- Diethyl [(Tert-Butoxycarbonyl)Amino]Propanedioate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Diethyl 2-(tert-Butoxycarbonylamino)malonate
CAS:Diethyl 2-(tert-Butoxycarbonylamino)malonateFormula:C12H21NO6Purity:97%Molecular weight:275.3Diethyl (Boc-amino)malonate
CAS:Formula:C12H21NO6Purity:97%Color and Shape:LiquidMolecular weight:275.2982Diethyl 2-aminomalonate, N-BOC protected
CAS:Diethyl 2-aminomalonate, N-BOC protectedFormula:C12H21NO6Purity:97%Color and Shape:Colourless LiquidMolecular weight:275.29823Diethyl 2-(tert-Butoxycarbonylamino)malonate
CAS:Formula:C12H21NO6Purity:95%Color and Shape:LiquidMolecular weight:275.301Diethyl (Boc-amino)malonate
CAS:Controlled ProductFormula:C12H21NO6Color and Shape:NeatMolecular weight:275.3




