CAS 102842-51-3
:3-Oxo Ropinirole (Ropinirole Impurity C)
Description:
3-Oxo Ropinirole, also known as Ropinirole Impurity C, is a chemical compound associated with the pharmaceutical drug Ropinirole, which is primarily used in the treatment of Parkinson's disease and Restless Legs Syndrome. This substance is characterized by its structural features, which include a piperidine ring and a ketone functional group, contributing to its chemical reactivity and potential biological activity. As an impurity, it may arise during the synthesis of Ropinirole and can influence the overall efficacy and safety profile of the final pharmaceutical product. The compound's molecular weight, solubility, and stability under various conditions are important for its characterization and analysis in quality control processes. Additionally, understanding its spectroscopic properties, such as NMR and mass spectrometry, is crucial for identification and quantification in pharmaceutical formulations. Regulatory guidelines often necessitate the monitoring of such impurities to ensure compliance with safety standards and therapeutic effectiveness.
Formula:C16H22N2O2
InChI:InChI=1S/C16H22N2O2/c1-3-9-18(10-4-2)11-8-12-6-5-7-13-14(12)15(19)16(20)17-13/h5-7H,3-4,8-11H2,1-2H3,(H,17,19,20)
InChI key:VBMMNCUKXRDGAZ-UHFFFAOYSA-N
SMILES:CCCN(CCC)CCC1=C2C(=CC=C1)NC(=O)C2=O
Synonyms:- 4-[2-(Dipropylamino)ethyl]-1H-indole-2,3-dione
- 4-[2-(Dipropylamino)ethyl]isatin
- Ropinirole Impurity C
- Skf 96266
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

