CymitQuimica logo

CAS 1028647-93-9

:

3-(4-bromophenyl)-9-phenyl-9H-Carbazole

Description:
3-(4-Bromophenyl)-9-phenyl-9H-carbazole is an organic compound characterized by its complex structure, which includes a carbazole core substituted with both a bromophenyl and a phenyl group. This compound typically exhibits properties associated with aromatic compounds, such as stability and a tendency to engage in π-π stacking interactions. The presence of the bromine atom introduces both electronic and steric effects, potentially influencing its reactivity and solubility. Carbazole derivatives are known for their applications in organic electronics, particularly in light-emitting diodes (LEDs) and organic photovoltaics, due to their favorable electronic properties. Additionally, the compound may exhibit fluorescence, making it useful in various photonic applications. Its synthesis often involves multi-step organic reactions, and it may be characterized using techniques such as NMR spectroscopy, mass spectrometry, and X-ray crystallography to confirm its structure and purity. Overall, 3-(4-bromophenyl)-9-phenyl-9H-carbazole represents a significant compound in the field of organic materials and chemistry.
Formula:C24H16BrN
InChI:InChI=1S/C24H16BrN/c25-19-13-10-17(11-14-19)18-12-15-24-22(16-18)21-8-4-5-9-23(21)26(24)20-6-2-1-3-7-20/h1-16H
InChI key:JEYLGFCAZBGCMC-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)N2C3=C(C=C(C=C3)C4=CC=C(C=C4)Br)C5=CC=CC=C52
Synonyms:
  • 3-(4-bromophenyl)-N-phenyl-9H-Carbazole
  • 3-(4-bromophenyl)-N-phenylcarbazole
  • 3-(4-Bromophenyl)-9-phenyl-carbazole
Found 5 products.