CymitQuimica logo

CAS 102878-18-2

:

2,4-DICHLORO-6-METHYLQUINOLINE

Description:
2,4-Dichloro-6-methylquinoline is a heterocyclic organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of two chlorine atoms at the 2 and 4 positions and a methyl group at the 6 position contributes to its unique chemical properties. This compound is typically a pale yellow to brown solid and is sparingly soluble in water but more soluble in organic solvents. It exhibits moderate stability under standard conditions but may undergo reactions typical of quinoline derivatives, such as electrophilic substitution and nucleophilic attack. 2,4-Dichloro-6-methylquinoline is of interest in various fields, including medicinal chemistry and agrochemicals, due to its potential biological activities and applications. Safety data indicate that it should be handled with care, as it may pose environmental and health risks. Proper storage and handling protocols are essential to mitigate any hazards associated with this compound.
Formula:C10H7Cl2N
InChI:InChI=1/C10H7Cl2N/c1-6-2-3-9-7(4-6)8(11)5-10(12)13-9/h2-5H,1H3
InChI key:GLYIJJUSFYXLNF-UHFFFAOYSA-N
SMILES:Cc1ccc2c(c1)c(cc(Cl)n2)Cl
Found 3 products.