CymitQuimica logo

CAS 102878-83-1

:

8-Quinolinol, 3-chloro-

Description:
8-Quinolinol, 3-chloro- is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a chlorine atom at the 3-position and a hydroxyl group at the 8-position contributes to its unique chemical properties. This compound is typically a pale yellow to brown solid and is soluble in organic solvents. It exhibits antimicrobial and antifungal activities, making it of interest in various applications, including pharmaceuticals and agricultural chemicals. The chlorine substituent can influence its reactivity and stability, potentially enhancing its biological activity. Additionally, 8-Quinolinol, 3-chloro- can participate in coordination chemistry, forming complexes with metal ions, which may be useful in analytical chemistry and materials science. Safety considerations should be taken into account, as with many halogenated compounds, due to potential toxicity and environmental impact. Overall, this compound serves as a valuable building block in synthetic organic chemistry and has implications in medicinal chemistry and materials development.
Formula:C9H6ClNO
InChI:InChI=1S/C9H6ClNO/c10-7-4-6-2-1-3-8(12)9(6)11-5-7/h1-5,12H
InChI key:JMXAPFATOSQMSP-UHFFFAOYSA-N
SMILES:C1=CC2=CC(=CN=C2C(=C1)O)Cl
Synonyms:
  • 3-Chloroquinolin-8-Ol
Found 4 products.