CymitQuimica logo

CAS 10288-11-6

:

BENZYL 2,3-DIBROMOPROPANOATE

Description:
Benzyl 2,3-dibromopropanoate is an organic compound characterized by its ester functional group, which is formed from the reaction of benzyl alcohol and 2,3-dibromopropanoic acid. It typically appears as a colorless to pale yellow liquid with a sweet, fruity odor. The presence of bromine atoms in its structure contributes to its reactivity, making it useful in various chemical syntheses, particularly in the field of organic chemistry. This compound is often employed as an intermediate in the synthesis of pharmaceuticals and agrochemicals. Its molecular structure includes a benzyl group, which enhances its lipophilicity, allowing for better solubility in organic solvents. Additionally, the dibromopropanoate moiety can participate in nucleophilic substitution reactions, making it a versatile building block in organic synthesis. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Proper storage and handling protocols are essential to mitigate any potential hazards associated with this compound.
Formula:C10H10Br2O2
InChI:InChI=1/C10H10Br2O2/c11-6-9(12)10(13)14-7-8-4-2-1-3-5-8/h1-5,9H,6-7H2
SMILES:c1ccc(cc1)COC(=O)C(CBr)Br
Synonyms:
  • Benzyl 2,3-dibromopropanoate
  • Propanoic acid, 2,3-dibromo-, phenylmethyl ester
Found 1 products.