CAS 102940-86-3
:2-CHLORO-3-FLUOROBENZOIC ACID
Description:
2-Chloro-3-fluorobenzoic acid is an aromatic carboxylic acid characterized by the presence of both chlorine and fluorine substituents on the benzene ring. The chlorine atom is located at the second position, while the fluorine atom is at the third position relative to the carboxylic acid group. This compound typically appears as a white to off-white solid and is known for its moderate solubility in organic solvents and limited solubility in water, which is common for halogenated benzoic acids. It exhibits acidic properties due to the carboxylic acid functional group, allowing it to participate in various chemical reactions, including esterification and nucleophilic substitution. The presence of halogens can influence its reactivity and polarity, making it useful in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Overall, 2-chloro-3-fluorobenzoic acid is a valuable compound in chemical research and industrial applications.
Formula:C7H4ClFO2
InChI:InChI=1/C7H4ClFO2/c8-6-4(7(10)11)2-1-3-5(6)9/h1-3H,(H,10,11)
SMILES:c1cc(c(c(c1)F)Cl)C(=O)O
Synonyms:- Buttpark 19\01-64
- 2-Chloro-3-Fluorobenzoic
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Chloro-3-fluorobenzoic acid
CAS:2-Chloro-3-fluorobenzoic acidFormula:C7H4ClFO2Purity:≥95%Color and Shape:Cream SolidMolecular weight:174.556862-Chloro-3-fluorobenzoic acid
CAS:Formula:C7H4ClFO2Purity:97%Color and Shape:SolidMolecular weight:174.55692-Chloro-3-fluorobenzoic Acid
CAS:Formula:C7H4ClFO2Purity:>97.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:174.562-Chloro-3-fluorobenzoic acid
CAS:2-Chloro-3-fluorobenzoic acid is a common intermediate used in organic synthesis. It can be synthesized by the halogenation of 2,4-dichlorophenol with
chlorine or bromine followed by nitration and reduction. This compound is an important reagent for generating various heterocycles. It is characterized by a coefficient of 0.5 (palladium), which makes it useful for analytical methods that require a high level of purity, such as spectroscopic analysis. The chemical diversity descriptor demonstrates the variety of chemical reactions that this compound has undergone during its synthesis.Formula:C7H4ClFO2Purity:Min. 95%Color and Shape:PowderMolecular weight:174.56 g/mol2-Chloro-3-fluorobenzoic acid
CAS:Formula:C7H4ClFO2Purity:96%Color and Shape:SolidMolecular weight:174.562-Chloro-3-fluorobenzoic acid
CAS:2-Chloro-3-fluorobenzoic acidFormula:C7H4ClFO2Purity:97%Molecular weight:174.56





