
CAS 1029654-22-5
:B-(2-Chloro-5-phenyl-3-pyridinyl)boronic acid
Description:
B-(2-Chloro-5-phenyl-3-pyridinyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols and other nucleophiles. This compound features a pyridine ring substituted with a chlorine atom and a phenyl group, contributing to its unique chemical properties. The boronic acid moiety allows for participation in various chemical reactions, including Suzuki coupling, which is widely utilized in organic synthesis for forming carbon-carbon bonds. The presence of the chlorine atom can influence the reactivity and solubility of the compound, while the phenyl group may enhance its stability and electronic properties. B-(2-Chloro-5-phenyl-3-pyridinyl)boronic acid is of interest in medicinal chemistry and materials science, particularly in the development of pharmaceuticals and functional materials. Its specific reactivity and interactions can be further explored in various applications, including drug discovery and the synthesis of complex organic molecules.
Formula:C11H9BClNO2
InChI:InChI=1S/C11H9BClNO2/c13-11-10(12(15)16)6-9(7-14-11)8-4-2-1-3-5-8/h1-7,15-16H
InChI key:InChIKey=HPMJKPKHFLLPFX-UHFFFAOYSA-N
SMILES:B(O)(O)C1=CC(=CN=C1Cl)C2=CC=CC=C2
Synonyms:- Boronic acid, B-(2-chloro-5-phenyl-3-pyridinyl)-
- B-(2-Chloro-5-phenyl-3-pyridinyl)boronic acid
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
