CymitQuimica logo

CAS 1029654-26-9

:

B-(2-Methoxy-6-phenyl-3-pyridinyl)boronic acid

Description:
B-(2-Methoxy-6-phenyl-3-pyridinyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols and other nucleophiles. This compound features a pyridine ring substituted with a methoxy and a phenyl group, contributing to its unique electronic and steric properties. The presence of the boronic acid moiety allows it to participate in various chemical reactions, including Suzuki coupling, which is widely used in organic synthesis for forming carbon-carbon bonds. Additionally, the methoxy and phenyl substituents can influence the compound's solubility, reactivity, and interaction with biological systems. B-(2-Methoxy-6-phenyl-3-pyridinyl)boronic acid may also exhibit potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its structural characteristics and reactivity make it a valuable compound in both synthetic and medicinal chemistry contexts.
Formula:C12H12BNO3
InChI:InChI=1S/C12H12BNO3/c1-17-12-10(13(15)16)7-8-11(14-12)9-5-3-2-4-6-9/h2-8,15-16H,1H3
InChI key:InChIKey=QKCHRZYPRDYABC-UHFFFAOYSA-N
SMILES:O(C)C1=NC(=CC=C1B(O)O)C2=CC=CC=C2
Synonyms:
  • 2-Methoxy-6-phenylpyridine-3-boronic acid
  • (2-Methoxy-6-phenylpyridin-3-yl)boronicacid
  • B-(2-Methoxy-6-phenyl-3-pyridinyl)boronic acid
  • (2-Methoxy-6-phenylpyridin-3-yl)boronic acid
  • Boronic acid, B-(2-methoxy-6-phenyl-3-pyridinyl)-
Found 2 products.