CymitQuimica logo

CAS 1029721-23-0

:

Pyrido[3,4-c]pyridazine,3-chloro-5,6,7,8-tetrahydro-

Description:
Pyrido[3,4-c]pyridazine, 3-chloro-5,6,7,8-tetrahydro- is a heterocyclic organic compound characterized by its fused pyridine and pyridazine rings, which contribute to its unique chemical properties. The presence of a chlorine atom at the 3-position and the tetrahydro configuration indicates that the compound has undergone partial hydrogenation, resulting in a saturated structure that can influence its reactivity and stability. This compound may exhibit biological activity due to its structural features, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential interactions with biological targets, which could lead to various pharmacological effects. Additionally, the compound's solubility, melting point, and other physical properties would depend on its specific molecular interactions and the presence of functional groups. As with many heterocycles, it may also participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks, making it a versatile building block in organic synthesis.
Formula:C7H8ClN3
InChI:InChI=1S/C7H8ClN3/c8-7-3-5-1-2-9-4-6(5)10-11-7/h3,9H,1-2,4H2
InChI key:RXBBFWAJORBXOQ-UHFFFAOYSA-N
SMILES:C1CNCC2=NN=C(C=C21)Cl
Synonyms:
  • 3-Chloro-5,6,7,8-tetrahydropyrido[3,4-c]pyridazine
  • pyrido[3,4-c]pyridazine, 3-chloro-5,6,7,8-tetrahydro-
Found 1 products.