CymitQuimica logo

CAS 102976-62-5

:

1H-Benzimidazol-2-ol(9CI)

Description:
1H-Benzimidazol-2-ol, also known as 9CI, is an organic compound characterized by its benzimidazole core structure, which consists of a fused benzene and imidazole ring. This compound features a hydroxyl (-OH) group at the 2-position of the benzimidazole ring, contributing to its chemical reactivity and potential biological activity. It is typically a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the presence of the hydroxyl group. 1H-Benzimidazol-2-ol exhibits properties that may include antimicrobial, antifungal, and antioxidant activities, making it of interest in pharmaceutical and agricultural applications. Its molecular structure allows for various functionalizations, which can enhance its efficacy in different chemical environments. Additionally, the compound's stability and reactivity can be influenced by pH and the presence of other chemical species. Overall, 1H-Benzimidazol-2-ol is a versatile compound with significant potential in various fields of research and industry.
Formula:C7H6N2O
InChI:InChI=1S/C7H6N2O/c10-7-8-5-3-1-2-4-6(5)9-7/h1-4H,(H2,8,9,10)
InChI key:SILNNFMWIMZVEQ-UHFFFAOYSA-N
SMILES:C1=CC=C2C(=C1)NC(=O)N2
Found 2 products.