CymitQuimica logo

CAS 10299-69-1

:

1H-Pyrrolo[2,3-b]pyridine, 2,3-dimethyl-

Description:
1H-Pyrrolo[2,3-b]pyridine, 2,3-dimethyl- is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. This compound features two methyl groups at the 2 and 3 positions of the pyrrole ring, influencing its reactivity and solubility. It is typically a solid at room temperature and exhibits moderate polarity due to the presence of nitrogen atoms in its structure. The compound is of interest in various fields, including medicinal chemistry, due to its potential biological activities and applications in drug development. Its molecular structure allows for interactions with biological targets, making it a candidate for further research in pharmacology. Additionally, 1H-Pyrrolo[2,3-b]pyridine derivatives have been studied for their roles in organic synthesis and as building blocks in the development of more complex molecules. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper laboratory practices.
Formula:C9H10N2
InChI:InChI=1/C9H10N2/c1-6-7(2)11-9-8(6)4-3-5-10-9/h3-5H,1-2H3,(H,10,11)
InChI key:MXNHEZZBSKBOHW-UHFFFAOYSA-N
SMILES:Cc1c(C)[nH]c2c1cccn2
Synonyms:
  • 2,3-Dimethyl-1H-pyrrolo[2,3-b]pyridin
  • 2,3-dimethyl-1H-pyrrolo[2,3-b]pyridine
Found 3 products.