CAS 103-43-5
:Dibenzyl succinate
Description:
Dibenzyl succinate, with the CAS number 103-43-5, is an organic compound classified as a diester. It is formed from the reaction of succinic acid and benzyl alcohol. This compound typically appears as a colorless to pale yellow liquid with a characteristic odor. It is known for its low solubility in water but is soluble in organic solvents such as ethanol and ether. Dibenzyl succinate exhibits a relatively high boiling point and moderate viscosity, making it useful in various applications, including as a plasticizer, solvent, and in the synthesis of other chemical compounds. Additionally, it has potential applications in the fragrance industry due to its pleasant aroma. The compound is generally considered to have low toxicity, but like many organic chemicals, it should be handled with care to avoid inhalation or skin contact. Its stability under normal conditions makes it suitable for use in various formulations, although it may undergo hydrolysis in the presence of strong acids or bases.
Formula:C18H18O4
InChI:InChI=1S/C18H18O4/c19-17(21-13-15-7-3-1-4-8-15)11-12-18(20)22-14-16-9-5-2-6-10-16/h1-10H,11-14H2
InChI key:InChIKey=ODBOBZHTGBGYCK-UHFFFAOYSA-N
SMILES:C(OC(CCC(OCC1=CC=CC=C1)=O)=O)C2=CC=CC=C2
Synonyms:- Benzyl succinate
- Butanedioic acid dibenzyl ester~Succinic acid dibenzyl ester
- Butanedioic acid, 1,4-bis(phenylmethyl) ester
- Butanedioic acid, bis(phenylmethyl) ester
- Dibenzyl succinate, (Succinic acid dibenzyl ester)
- Dibenzyl Butanedioate
- NSC 4047
- Spasmine
- Succinic acid dibenzyl ester
- Dibenzyl succinate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Dibenzyl succinate, 98%
CAS:<p>Dibenzyl succinate is used as an organic chemical synthesis intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU</p>Formula:C18H18O4Purity:98%Color and Shape:White, Crystals or powder or crystalline powderMolecular weight:298.34
