CAS 103-43-5: Dibenzyl succinate

Description:Dibenzyl succinate, with the CAS number 103-43-5, is an organic compound classified as a diester. It is formed from the reaction of succinic acid and benzyl alcohol. This compound typically appears as a colorless to pale yellow liquid with a characteristic odor. It is known for its low solubility in water but is soluble in organic solvents such as ethanol and ether. Dibenzyl succinate exhibits a relatively high boiling point and moderate viscosity, making it useful in various applications, including as a plasticizer, solvent, and in the synthesis of other chemical compounds. Additionally, it has potential applications in the fragrance industry due to its pleasant aroma. The compound is generally considered to have low toxicity, but like many organic chemicals, it should be handled with care to avoid inhalation or skin contact. Its stability under normal conditions makes it suitable for use in various formulations, although it may undergo hydrolysis in the presence of strong acids or bases.

Formula:C₁₈H₁₈O₄

InChI:InChI=1S/C18H18O4/c19-17(21-13-15-7-3-1-4-8-15)11-12-18(20)22-14-16-9-5-2-6-10-16/h1-10H,11-14H2

InChI key:InChIKey=ODBOBZHTGBGYCK-UHFFFAOYSA-N

SMILES:O=C(OCC=1C=CC=CC1)CCC(=O)OCC=2C=CC=CC2

Synonyms:
Benzyl succinate
Butanedioic acid dibenzyl ester~Succinic acid dibenzyl ester
Butanedioic acid, 1,4-bis(phenylmethyl) ester
Butanedioic acid, bis(phenylmethyl) ester
Dibenzyl succinate, (Succinic acid dibenzyl ester)
Dibenzyl Butanedioate
NSC 4047
Spasmine
Succinic acid dibenzyl ester
Dibenzyl succinate
See more synonyms

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	Dibenzyl succinate, 98% REF: 02-B25257CAS: 103-43-5	98%	To inquire	Fri 18 Jul 25
	Dibenzyl succinate REF: 3D-AAA10343CAS: 103-43-5	Min. 95%	- - -	Discontinued product