CymitQuimica logo

CAS 103011-38-7

:

3-(1,3-DIOXOLAN-2-YL)THIOPHENE-2-SULFONYL CHLORIDE

Description:
3-(1,3-Dioxolan-2-yl)thiophene-2-sulfonyl chloride is a chemical compound characterized by its unique structure, which includes a thiophene ring, a dioxolane moiety, and a sulfonyl chloride functional group. This compound typically appears as a solid or liquid, depending on the specific conditions, and is known for its reactivity due to the presence of the sulfonyl chloride group, which can participate in nucleophilic substitution reactions. The dioxolane ring contributes to its stability and solubility in various organic solvents. It is often utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to act as a sulfonylating agent. Additionally, the compound may exhibit interesting electronic properties owing to the conjugation between the thiophene and sulfonyl groups, making it a subject of interest in materials science and organic electronics. Safety precautions should be observed when handling this compound, as sulfonyl chlorides can be corrosive and may release toxic gases upon reaction with water or amines.
Formula:C7H7ClO4S2
InChI:InChI=1/C7H7ClO4S2/c8-14(9,10)7-5(1-4-13-7)6-11-2-3-12-6/h1,4,6H,2-3H2
SMILES:c1csc(c1C1OCCO1)S(=O)(=O)Cl
Synonyms:
  • 3-(1,3-Dioxolan-2-Yl)Thiophene-2-Sulphonyl Chloride
  • 3-(1,3-Dioxolan-2-yl)thiophene-2-sulphonyl chloride 97%
Found 1 products.