CymitQuimica logo

CAS 103030-70-2

:

1,2,3,4-Tetrahydro-5-methoxyisoquinoline

Description:
1,2,3,4-Tetrahydro-5-methoxyisoquinoline is a chemical compound characterized by its bicyclic structure, which includes a saturated tetrahydroisoquinoline framework with a methoxy group at the 5-position. This compound is part of a larger class of isoquinoline derivatives, which are known for their diverse biological activities. The presence of the methoxy group can influence the compound's solubility, reactivity, and interaction with biological targets. Typically, isoquinoline derivatives exhibit a range of pharmacological properties, including potential neuroprotective, analgesic, and anti-inflammatory effects. The compound's molecular structure suggests it may participate in various chemical reactions, including alkylation and oxidation, and it may serve as a precursor for synthesizing more complex molecules. Its specific applications and effects would depend on further research, particularly in medicinal chemistry and pharmacology, where such compounds are often explored for therapeutic potential. As with any chemical substance, safety and handling precautions are essential, given the potential for toxicity or reactivity.
Formula:C10H13NO
InChI:InChI=1S/C10H13NO/c1-12-10-4-2-3-8-7-11-6-5-9(8)10/h2-4,11H,5-7H2,1H3
InChI key:InChIKey=MCJYXDLWQYGCIQ-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(=CC=C1)CNCC2
Synonyms:
  • 1,2,3,4-Tetrahydro-5-methoxyisoquinoline
  • 5-Methoxy-1,2,3,4-tetrahydroisoquinoline
  • Isoquinoline, 1,2,3,4-tetrahydro-5-methoxy-
Found 3 products.