CymitQuimica logo

CAS 103031-30-7

:

5,5,8,8-tetramethyl-5,6,7,8-tetrahydro-2-naphthalenecarboxylic acid

Description:
5,5,8,8-Tetramethyl-5,6,7,8-tetrahydro-2-naphthalenecarboxylic acid is an organic compound characterized by its complex bicyclic structure, which includes a naphthalene moiety. This compound features four methyl groups attached to the tetrahydronaphthalene framework, contributing to its steric bulk and potentially influencing its reactivity and solubility. The presence of a carboxylic acid functional group indicates that it can participate in acid-base reactions and may exhibit acidic properties. Its molecular structure suggests that it may have applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. The compound's unique arrangement of substituents may also impart specific physical properties, such as melting and boiling points, which are influenced by intermolecular forces. Additionally, the compound's CAS number, 103031-30-7, allows for easy identification and retrieval of information in chemical databases. Overall, this compound exemplifies the diversity of organic chemistry and the significance of structural variations in determining chemical behavior.
Formula:C15H20O2
InChI:InChI=1/C15H20O2/c1-14(2)7-8-15(3,4)12-9-10(13(16)17)5-6-11(12)14/h5-6,9H,7-8H2,1-4H3,(H,16,17)
InChI key:KSEZYZSBKCPEKP-UHFFFAOYSA-N
SMILES:CC1(C)CCC(C)(C)c2cc(ccc12)C(=O)O
Synonyms:
  • 5,5,8,8-Tetramethyl-5,6,7,8-Tetrahydronaphthalene-2-Carboxylic Acid
  • 5,5,8,8-Tetramethyl-5,6,7,8-tetrahydro-2- naphthalenecarboxylic acid
Found 4 products.