CymitQuimica logo

CAS 1030380-38-1

:

1,3-Bis[3,5-di(pyridin-3-yl)phenyl]benzene

Description:
1,3-Bis[3,5-di(pyridin-3-yl)phenyl]benzene is an organic compound characterized by its complex molecular structure, which features a central benzene ring substituted at the 1 and 3 positions with two identical 3,5-di(pyridin-3-yl)phenyl groups. This compound exhibits significant aromatic character due to the presence of multiple aromatic rings, contributing to its stability and potential electronic properties. The pyridine moieties introduce nitrogen atoms into the structure, which can enhance solubility in polar solvents and may facilitate coordination with metal ions, making it of interest in coordination chemistry and materials science. Additionally, the presence of multiple aromatic systems can lead to interesting photophysical properties, such as fluorescence or phosphorescence, which may be exploited in organic light-emitting diodes (OLEDs) or as luminescent probes. Its synthesis typically involves multi-step organic reactions, and its applications may extend to organic electronics, sensors, or as intermediates in the synthesis of more complex molecules. Overall, this compound represents a fascinating example of functionalized aromatic systems in organic chemistry.
Formula:C38H26N4
InChI:InChI=1S/C38H26N4/c1-6-27(33-17-35(29-8-2-12-39-23-29)21-36(18-33)30-9-3-13-40-24-30)16-28(7-1)34-19-37(31-10-4-14-41-25-31)22-38(20-34)32-11-5-15-42-26-32/h1-26H
InChI key:WCXKTQVEKDHQIY-UHFFFAOYSA-N
SMILES:C1=CC(=CC(=C1)C2=CC(=CC(=C2)C3=CN=CC=C3)C4=CN=CC=C4)C5=CC(=CC(=C5)C6=CN=CC=C6)C7=CN=CC=C7
Synonyms:
  • 3,1''-terphenyl
  • 1,3-Bis(3,5-dipyrid-3-ylphenyl)benzene
  • B 3PyPB
  • BmPyPhB
  • 3,5,3'',5''-Tetra-3-pyridyl-1,1'
  • 1,3-Bis(3,5-dipyrid-3-ylphenyl)benzene
  • LT-N865
Found 2 products.