CymitQuimica logo

CAS 103068-20-8

:

1-bromo-3,5-diphenylbenzene

Description:
1-Bromo-3,5-diphenylbenzene, with the CAS number 103068-20-8, is an organic compound characterized by the presence of a bromine atom attached to a benzene ring that is further substituted at the 3 and 5 positions by phenyl groups. This compound belongs to the class of brominated aromatic hydrocarbons, which are known for their stability and potential applications in organic synthesis and materials science. The presence of multiple phenyl groups contributes to its rigidity and can influence its electronic properties, making it a candidate for various chemical reactions, including electrophilic substitutions. Additionally, the bromine substituent can serve as a useful handle for further functionalization, allowing for the introduction of other chemical groups. The compound's physical properties, such as melting point, boiling point, and solubility, are influenced by its molecular structure and the interactions between its aromatic rings. Overall, 1-bromo-3,5-diphenylbenzene is of interest in both academic research and industrial applications due to its unique structural features.
Formula:C18H13Br
InChI:InChI=1S/C18H13Br/c19-18-12-16(14-7-3-1-4-8-14)11-17(13-18)15-9-5-2-6-10-15/h1-13H
InChI key:IOPQERQQZZREDR-UHFFFAOYSA-N
SMILES:c1ccc(cc1)c1cc(cc(c1)Br)c1ccccc1
Synonyms:
  • 5'-Bromo-1,1':3',1''-Terphenyl
  • 3',5'-Diphenylbromobenzene
Found 5 products.