CymitQuimica logo

CAS 1030832-38-2

:

5-Fluoro-2-Methylbenzeneboronic acid pinacol ester, 97%

Description:
5-Fluoro-2-Methylbenzeneboronic acid pinacol ester is an organoboron compound characterized by the presence of a boronic acid moiety esterified with pinacol, alongside a fluorinated aromatic ring. This compound typically exhibits a white to off-white solid appearance and is soluble in organic solvents such as dichloromethane and ethanol, while being less soluble in water. The presence of the fluorine atom enhances its reactivity and can influence its electronic properties, making it useful in various synthetic applications, particularly in cross-coupling reactions like Suzuki-Miyaura coupling. The pinacol ester functionality provides stability and can facilitate the handling and storage of the boronic acid derivative. This compound is often utilized in medicinal chemistry and materials science for the development of pharmaceuticals and advanced materials due to its ability to form stable complexes with various substrates. As with many organoboron compounds, it is essential to handle it with care, following appropriate safety protocols, as it may pose health risks if ingested or inhaled.
Formula:C13H20BFO3
InChI:InChI=1S/C13H18BFO2/c1-9-6-7-10(15)8-11(9)14-16-12(2,3)13(4,5)17-14/h6-8H,1-5H3
InChI key:ZTKSYTPCVNDCIE-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)F)C
Found 5 products.