CAS 10312-55-7
:2-AMINOTEREPHTHALIC ACID
Description:
2-Aminoterephthalic acid, with the CAS number 10312-55-7, is an aromatic compound characterized by the presence of both amino and carboxylic acid functional groups. It features a benzene ring with two carboxylic acid groups located at the 1 and 4 positions, and an amino group at the 2 position, making it a derivative of terephthalic acid. This compound is typically a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols. Its chemical structure allows for hydrogen bonding, which contributes to its solubility and reactivity. 2-Aminoterephthalic acid is often used in the synthesis of various polymers, dyes, and pharmaceuticals, and it can serve as a building block in the production of high-performance materials. Additionally, it exhibits potential applications in the field of biochemistry and materials science due to its functional groups, which can participate in various chemical reactions, including condensation and coupling reactions.
Formula:C8H5NO4
InChI:InChI=1/C8H7NO4/c9-6-3-4(7(10)11)1-2-5(6)8(12)13/h1-3H,9H2,(H,10,11)(H,12,13)/p-2
SMILES:c1cc(c(cc1C(=O)[O-])N)C(=O)[O-]
Synonyms:- 2-Aminobenzene-1,4-Dicarboxylic Acid
- 2-Amino-1,4-Benzenedicarboxylic Acid
- Timtec-Bb Sbb006751
- 2-Aminoterephthalic acid, 99+%
- 2-Aminoterephthalate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
2-Aminoterephthalic Acid
CAS:Formula:C8H7NO4Purity:>98.0%(T)(HPLC)Color and Shape:Light yellow to Amber to Dark green powder to crystalMolecular weight:181.152-Aminoterephthalic acid, 99%
CAS:2-Aminoterephthalic acid is used as a pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU referFormula:C8H5NO4Purity:99%Color and Shape:Powder, YellowMolecular weight:179.13Ref: IN-DA003909
1g21.00€5g29.00€10g31.00€25g52.00€50g71.00€100g113.00€250g189.00€500g234.00€1kg525.00€5kg963.00€10kg1,909.00€25kg4,446.00€2-Aminoterephthalic acid
CAS:2-Aminoterephthalic acidFormula:C8H7NO4Purity:≥95%Color and Shape:Yellow Solid-PowderMolecular weight:181.145482-Aminoterephthalic acid
CAS:Formula:C8H7NO4Purity:≥ 98.0%Color and Shape:White to yellow, amber or green powder or crystalsMolecular weight:181.152-Aminoterephthalic acid
CAS:2-Aminoterephthalic acid is a sulfa drug that has a skeleton containing two nitrogen atoms. It is a white, crystalline powder and can be dissolved in water. 2-Aminoterephthalic acid is used as an intermediate for the preparation of other sulfa drugs. The detection limit of this compound was determined to be 0.5 mg/L with the use of a chemiluminescence method and fluorescence probe. This compound reacts with acid to form an acid complex that can be detected by plasma mass spectrometry or electrochemical impedance spectroscopy.
Formula:C8H7NO4Purity:Min. 97 Area-%Color and Shape:White PowderMolecular weight:181.15 g/mol2-Aminoterephthalic acid
CAS:2-Aminoterephthalic acidFormula:C8H7NO4Purity:95%Molecular weight:181.15







