CymitQuimica logo

CAS 1031226-45-5

:

3-Chloro-2,6-difluorophenylboronic acid

Description:
3-Chloro-2,6-difluorophenylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is substituted with chlorine and fluorine atoms. This compound typically exhibits a white to off-white solid appearance and is soluble in polar solvents such as water and alcohols, owing to the boronic acid group. The presence of the chlorine and fluorine substituents can influence its reactivity and interaction with other chemical species, making it useful in various applications, including medicinal chemistry and materials science. Boronic acids are known for their ability to form reversible complexes with diols, which is significant in biological systems and synthetic chemistry. Additionally, 3-Chloro-2,6-difluorophenylboronic acid may serve as a key intermediate in the synthesis of pharmaceuticals and agrochemicals, particularly in Suzuki coupling reactions, which are widely used for forming carbon-carbon bonds. Its unique electronic properties and functionalization potential make it a valuable compound in organic synthesis.
Formula:C6H4BClF2O2
InChI:InChI=1S/C6H4BClF2O2/c8-3-1-2-4(9)5(6(3)10)7(11)12/h1-2,11-12H
InChI key:ZSMAOKOKSOKHOU-UHFFFAOYSA-N
SMILES:B(C1=C(C=CC(=C1F)Cl)F)(O)O
Found 4 products.