CymitQuimica logo

CAS 1031413-61-2

:

"Spiro[2H-1-benzopyran-2,4'-piperidin]-4(3H)-one, 1'-(1H-indazol-7-ylcarbonyl)-6-methyl-

Description:
Spiro[2H-1-benzopyran-2,4'-piperidin]-4(3H)-one, 1'-(1H-indazol-7-ylcarbonyl)-6-methyl- is a complex organic compound characterized by its unique spirocyclic structure, which combines a benzopyran moiety with a piperidinone framework. This compound features a carbonyl group attached to an indazole ring, contributing to its potential biological activity. The presence of the methyl group at the 6-position of the benzopyran enhances its lipophilicity, which may influence its interaction with biological targets. The spiro arrangement often imparts distinctive stereochemical properties, potentially affecting the compound's reactivity and binding affinity in pharmacological contexts. Additionally, the compound may exhibit interesting photophysical properties due to the conjugated systems present in its structure. Overall, this compound's unique architecture suggests potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. Further studies would be necessary to elucidate its specific biological activities and mechanisms of action.
Formula:C22H21N3O3
InChI:InChI=1S/C22H21N3O3/c1-14-5-6-19-17(11-14)18(26)12-22(28-19)7-9-25(10-8-22)21(27)16-4-2-3-15-13-23-24-20(15)16/h2-6,11,13H,7-10,12H2,1H3,(H,23,24)
InChI key:IKCMGTBANLMNNP-UHFFFAOYSA-N
SMILES:CC1=CC2=C(C=C1)OC3(CCN(CC3)C(=O)C4=CC=CC5=C4NN=C5)CC2=O
Found 2 products.