CAS 10320-49-7
:3-(dimethylamino)-1-(naphthalen-5-yl)propan-1-one
Description:
3-(Dimethylamino)-1-(naphthalen-5-yl)propan-1-one, also known by its CAS number 10320-49-7, is an organic compound characterized by its structure, which includes a naphthalene ring and a dimethylamino group attached to a propanone backbone. This compound typically appears as a solid or liquid depending on its purity and conditions. It is known for its potential applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and dyes. The presence of the dimethylamino group imparts basic properties, making it a potential nucleophile in chemical reactions. Additionally, the naphthalene moiety contributes to its aromatic characteristics, which can influence its reactivity and stability. The compound may exhibit fluorescence, making it useful in certain analytical applications. Safety data should be consulted, as it may pose health risks if not handled properly, including potential irritant effects. Overall, this compound is of interest in both academic and industrial chemistry for its unique structural features and reactivity.
Formula:C15H17NO
InChI:InChI=1/C15H17NO/c1-16(2)11-10-15(17)14-9-5-7-12-6-3-4-8-13(12)14/h3-9H,10-11H2,1-2H3
SMILES:CN(C)CCC(=O)c1cccc2ccccc12
Synonyms:- 1-Propanone, 3-(Dimethylamino)-1-(1-Naphthalenyl)-
- 3-(Dimethylamino)-1-(1-naphthyl)propan-1-on
- 3-(Dimethylamino)-1-(1-naphthyl)propan-1-one
- 3-(Dimethylamino)-1-(Naphthalen-1-Yl)Propan-1-One
- 2-(Dimethylamino)ethyl 1-naphthyl ketone
- 3-(dimethylamino)-1-(1-naphthalenyl)-1-propanone
- (2-alpha-Naphthoylethyl)dimethylamine
- 3-(dimethylamino)-1-(phthalen-5-yl)propan-1-one
- 3-(dimethylamino)-1-(naphthalen-5-yl)propan-1-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
3-(Dimethylamino)-1-(naphthalen-1-yl)propan-1-one
CAS:3-(Dimethylamino)-1-(naphthalen-1-yl)propan-1-oneFormula:C15H17NOPurity:97%Molecular weight:227.313-(Dimethylamino)-1-(naphthalen-1-yl)propan-1-one
CAS:3-(Dimethylamino)-1-(naphthalen-1-yl)propan-1-oneFormula:C15H17NOPurity:97%Molecular weight:227.33-(Dimethylamino)-1-(naphthalen-5-yl)propan-1-one
CAS:Formula:C15H17NOPurity:97%Color and Shape:Viscous Liquid, SolidMolecular weight:227.3073-(Dimethylamino)-1-(1-naphthalenyl)-1-propanone-D6
CAS:Controlled ProductApplications 3-(Dimethylamino)-1-(1-Naphthalenyl)-1-Propanone-D6 is a reagent in the synthesis of Bedaquiline-d6 (Mixture of Diastereomers) (B119552) which is the labelled analog of Bedaquiline, a diarylquinoline derivative that acts as a mycobacterial inhibitor. Bedaquiline shows promise as potential drug in the treatment of tuberculosis.
References de Jonge M.R. et al.: Proteins, 67, 971 (2007); Diacon A.H. et al.: N. Eng. J. Med., 360, 2397 (2009);Formula:C15D6H11NOColor and Shape:NeatMolecular weight:233.3393-(dimethylamino)-1-(naphthalen-5-yl)propan-1-one
CAS:Formula:C15H17NOPurity:97%Color and Shape:SolidMolecular weight:227.3016






