CAS 103203-84-5
:3,4-Dihydro-2H-1-benzopyran-6-carboxylic acid
Description:
3,4-Dihydro-2H-1-benzopyran-6-carboxylic acid, with the CAS number 103203-84-5, is a chemical compound characterized by its bicyclic structure, which includes a benzopyran moiety. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the dihydro group indicates that it has two hydrogen atoms added to the benzopyran structure, which can influence its reactivity and stability. Typically, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and pharmacology. The molecular structure suggests potential interactions with biological systems, possibly acting as a ligand or influencing metabolic pathways. Additionally, the compound's solubility and reactivity can be affected by the carboxylic acid group, which can participate in hydrogen bonding and other intermolecular interactions. Overall, 3,4-Dihydro-2H-1-benzopyran-6-carboxylic acid represents a unique chemical entity with potential applications in various fields, including organic synthesis and drug development.
Formula:C10H10O3
InChI:InChI=1S/C10H10O3/c11-10(12)8-3-4-9-7(6-8)2-1-5-13-9/h3-4,6H,1-2,5H2,(H,11,12)
InChI key:InChIKey=IFKANGOXGBPILW-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C2C(=CC1)OCCC2
Synonyms:- 2H-1-Benzopyran-6-carboxylic acid, 3,4-dihydro-
- 3,4-Dihydro-2H-1-benzopyran-6-carboxylic acid
- 3,4-Dihydro-2H-benzopyran-6-carboxylic acid
- 3,4-dihydro-2H-chromene-6-carboxylic acid
- 6-Chromancarboxylic acid
- Chromane-6-Carboxylic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Chroman-6-carboxylic acid
CAS:Chroman-6-carboxylic acidFormula:C10H10O3Purity:98%Molecular weight:178.19CHROMAN-6-CARBOXYLIC ACID
CAS:Formula:C10H10O3Purity:98%Color and Shape:SolidMolecular weight:178.1846Chroman-6-carboxylic acid
CAS:Chroman-6-carboxylic acidFormula:C10H10O3Purity:≥95%Color and Shape:Off-white SolidMolecular weight:178.1846Chroman-6-carboxylic acid
CAS:Formula:C10H10O3Purity:98%Color and Shape:Light beige powderMolecular weight:178.187Chroman-6-carboxylic acid
CAS:Chroman-6-carboxylic acid is a hydroxamic acid that is used in the production of carboxylate emulsions. It is an active substance that has been shown to inhibit the growth of bacteria and fungi. Chroman-6-carboxylic acid has also been shown to be a strong oxidizing agent, which can generate hydrogen peroxide in alkaline media. This agent also has functional groups such as carboxylate, chloride, and carboxylic acid.
Formula:C10H10O3Purity:Min. 95%Molecular weight:178.19 g/mol




