CAS 103213-38-3
:gly-leu-phe
Description:
The chemical substance known as "gly-leu-phe," with the CAS number 103213-38-3, is a tripeptide composed of three amino acids: glycine (Gly), leucine (Leu), and phenylalanine (Phe). This peptide exhibits characteristics typical of peptides, including the ability to participate in various biochemical reactions and interactions due to its functional groups. Glycine, being the simplest amino acid, contributes to the peptide's flexibility, while leucine and phenylalanine provide hydrophobic properties, influencing the peptide's overall structure and stability. Gly-leu-phe may play roles in biological processes, such as signaling pathways or as a building block for larger proteins. Its solubility in water and organic solvents can vary based on the pH and concentration, affecting its behavior in biological systems. Additionally, the peptide's sequence can impact its biological activity, making it of interest in fields such as biochemistry, pharmacology, and nutrition. Overall, gly-leu-phe is a representative example of how amino acid sequences can lead to diverse functional properties in peptides.
Formula:C17H25N3O4
InChI:InChI=1/C17H25N3O4/c1-11(2)8-13(19-15(21)10-18)16(22)20-14(17(23)24)9-12-6-4-3-5-7-12/h3-7,11,13-14H,8-10,18H2,1-2H3,(H,19,21)(H,20,22)(H,23,24)
SMILES:CC(C)CC(C(=NC(Cc1ccccc1)C(=O)O)O)N=C(CN)O
Synonyms:- Glycyl-leucyl-phenylalanine
- L-Gly-L-leu-L-phe
- L-Phenylalanine, N-(N-glycyl-L-leucyl)-
- glycyl-L-leucyl-L-phenylalanine
- H-Gly-Leu-Phe-OH
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
H-Gly-Leu-Phe-OH
CAS:H-Gly-Leu-Phe-OH is a peptide that has been isolated from human macrophages. The peptide is homologous to the amino acid sequence of casein and has shown anti-inflammatory properties in the inhibition of the enzymatic reaction between casein and sodium citrate. When incubated with polymorphonuclear leukocytes, H-Gly-Leu-Phe-OH showed an inhibitory effect on their growth. This peptide also inhibited the enzymatic reaction between casein and sodium citrate, which may be due to its reversed phase high performance liquid chromatography (RP HPLC) method.Formula:C17H25N3O4Purity:Min. 95%Molecular weight:335.4 g/molH-Gly-Leu-Phe-OH
CAS:GLF (H-Gly-Leu-Phe-OH), a tripeptide isolated from α-lactalbumin with immunostimulatory properties, prevents alopecia, epidermal thickening, and adipocyte layerFormula:C17H25N3O4Color and Shape:SolidMolecular weight:335.4



