CymitQuimica logo

CAS 103213-40-7

:

N-glutaryl-gly-arg 7-amido-4-*methylcoumarin hydr

Description:
N-glutaryl-gly-arg 7-amido-4-methylcoumarin hydrate is a synthetic compound that belongs to the class of peptide derivatives. It is characterized by the presence of a glutaryl group, glycine, and arginine, which contribute to its peptide nature. The 7-amido-4-methylcoumarin moiety serves as a fluorogenic marker, making this compound useful in biochemical assays, particularly for studying proteolytic activity. The hydrate form indicates that the compound contains water molecules in its crystalline structure, which can influence its solubility and stability. This compound is often utilized in research settings, particularly in enzymatic studies where it acts as a substrate for specific proteases, allowing for the monitoring of enzyme activity through fluorescence. Its unique structure and properties make it valuable in the development of assays for various biological applications, including drug discovery and enzyme characterization. As with many synthetic compounds, proper handling and safety measures should be observed due to potential biological activity.
Formula:C23H31ClN6O7
InChI:InChI=1/C23H30N6O7.ClH/c1-13-10-21(34)36-17-11-14(7-8-15(13)17)28-22(35)16(4-3-9-26-23(24)25)29-19(31)12-27-18(30)5-2-6-20(32)33;/h7-8,10-11,16H,2-6,9,12H2,1H3,(H,27,30)(H,28,35)(H,29,31)(H,32,33)(H4,24,25,26);1H
InChI key:JSJHBZGTMAWMAP-NTISSMGPSA-N
SMILES:Cc1cc(=O)oc2cc(ccc12)N=C(C(CCCNC(=N)N)N=C(CN=C(CCCC(=O)O)O)O)O.Cl
Synonyms:
  • Glutaryl-Gly-Arg-AMC . HCl
  • N-(4-carboxybutanoyl)glycyl-N5-(diaminomethylidene)-N-(4-methyl-2-oxo-2H-chromen-7-yl)ornithinamide hydrochloride
Found 3 products.