CAS 103213-40-7
:N-glutaryl-gly-arg 7-amido-4-*methylcoumarin hydr
Description:
N-glutaryl-gly-arg 7-amido-4-methylcoumarin hydrate is a synthetic compound that belongs to the class of peptide derivatives. It is characterized by the presence of a glutaryl group, glycine, and arginine, which contribute to its peptide nature. The 7-amido-4-methylcoumarin moiety serves as a fluorogenic marker, making this compound useful in biochemical assays, particularly for studying proteolytic activity. The hydrate form indicates that the compound contains water molecules in its crystalline structure, which can influence its solubility and stability. This compound is often utilized in research settings, particularly in enzymatic studies where it acts as a substrate for specific proteases, allowing for the monitoring of enzyme activity through fluorescence. Its unique structure and properties make it valuable in the development of assays for various biological applications, including drug discovery and enzyme characterization. As with many synthetic compounds, proper handling and safety measures should be observed due to potential biological activity.
Formula:C23H31ClN6O7
InChI:InChI=1/C23H30N6O7.ClH/c1-13-10-21(34)36-17-11-14(7-8-15(13)17)28-22(35)16(4-3-9-26-23(24)25)29-19(31)12-27-18(30)5-2-6-20(32)33;/h7-8,10-11,16H,2-6,9,12H2,1H3,(H,27,30)(H,28,35)(H,29,31)(H,32,33)(H4,24,25,26);1H
SMILES:Cc1cc(=O)oc2cc(ccc12)N=C(C(CCCNC(=N)N)N=C(CN=C(CCCC(=O)O)O)O)O.Cl
Synonyms:- Glutaryl-Gly-Arg-AMC . HCl
- N-(4-carboxybutanoyl)glycyl-N5-(diaminomethylidene)-N-(4-methyl-2-oxo-2H-chromen-7-yl)ornithinamide hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Glutaryl-gly-arg-amc hcl
CAS:Glutaryl-gly-arg-amc hclFormula:C23H31ClN6O7Purity:≥98%Molecular weight:538.98Glutaryl-glycyl-L-arginine 7-amido-4-methylcoumarin hydrochloride
CAS:Glutaryl-glycyl-L-arginine 7-amido-4-methylcoumarin hydrochloride is a synthetic peptide substrate used as a fluorogenic substrate for aminopeptidase.
Formula:C23H30N6O7·HClPurity:Min. 95%Color and Shape:PowderMolecular weight:538.98 g/molGlutaryl-glycyl-L-arginine 7-amido-4-methylcoumarin hydrochloride
CAS:Glutaryl-glycyl-L-arginine 7-amido-4-methylcoumarin hydrochloride is a chromogenic substrate that can be used in the detection of enzymes and other proteins. It is a fluorogenic substrate that can be used in chemiluminescence to detect and measure free radicals. Glutaryl-glycyl-L-arginine 7-amido-4-methylcoumarin hydrochloride is stable at pH 7, and has a high purity with a CAS number of 103213-40-7. This product is suitable for use as an enzyme substrate or ligand, as well as for staining and diagnostics.Formula:C23H31ClN6O7Molecular weight:538.98 g/molRef: 3D-G-3950
-Unit-ggTo inquire1gTo inquire25mgTo inquire100mgTo inquire250mgTo inquire500mgTo inquire


