CymitQuimica logo

CAS 103229-89-6

:

perfluoro(4-methylpent-2-enoic acid)

Description:
Perfluoro(4-methylpent-2-enoic acid) is a perfluorinated compound characterized by a carbon chain fully substituted with fluorine atoms, which imparts unique properties such as high thermal stability, chemical resistance, and low surface tension. This compound features a carboxylic acid functional group, contributing to its potential reactivity and solubility in polar solvents. The presence of the 4-methylpent-2-enoic structure indicates that it has a branched alkene configuration, which can influence its physical properties, such as boiling point and viscosity. Perfluorinated compounds are known for their hydrophobic and oleophobic characteristics, making them useful in various applications, including surfactants, coatings, and in the production of fluoropolymers. However, due to environmental concerns associated with perfluorinated substances, including their persistence and potential bioaccumulation, regulatory scrutiny has increased. Overall, perfluoro(4-methylpent-2-enoic acid) exemplifies the unique behavior of fluorinated compounds in both industrial applications and environmental contexts.
Formula:C6HF9O2
InChI:InChI=1/C6HF9O2/c7-1(3(16)17)2(8)4(9,5(10,11)12)6(13,14)15/h(H,16,17)/b2-1-
InChI key:TWDHAMRDYDLSPH-OWOJBTEDSA-N
SMILES:C(=C(\C(C(F)(F)F)(C(F)(F)F)F)/F)(\C(=O)O)/F
Synonyms:
  • Hexafluoromethylpentenoicacid
  • Hexafluoro-4-(trifluoromethyl)pent-2-enoic
  • (2E)-2,3,4,5,5,5-hexafluoro-4-(trifluoromethyl)pent-2-enoic acid
  • (Z)-2,3,4,5,5,5-hexafluoro-4-(trifluoromethyl)pent-2-enoic acid
Found 5 products.