
CAS 1032350-13-2: MK 2206 dihydrochloride
Description:MK 2206 dihydrochloride is a small molecule inhibitor that primarily targets the protein kinase AKT, which plays a crucial role in various cellular processes, including metabolism, proliferation, and survival. This compound is often studied in the context of cancer research due to its potential to inhibit tumor growth and enhance the efficacy of other therapeutic agents. MK 2206 dihydrochloride is characterized by its solubility in water, which facilitates its use in biological assays. The compound typically exhibits a moderate to high affinity for AKT, leading to the disruption of downstream signaling pathways associated with cell survival and growth. Its chemical structure includes a specific arrangement of functional groups that contribute to its biological activity. In preclinical studies, MK 2206 has shown promise in various cancer models, making it a candidate for further investigation in clinical settings. However, like many investigational drugs, its safety and efficacy in humans are subjects of ongoing research.
Formula:C25H21N5O·2ClH
InChI:InChI=1S/C25H21N5O.2ClH/c26-25(12-4-13-25)18-9-7-17(8-10-18)22-19(16-5-2-1-3-6-16)15-20-21(27-22)11-14-30-23(20)28-29-24(30)31;;/h1-3,5-11,14-15H,4,12-13,26H2,(H,29,31);2*1H
InChI key:InChIKey=HWUHTJIKQZZBRA-UHFFFAOYSA-N
SMILES:Cl.O=C1NN=C2C=3C=C(C=4C=CC=CC4)C(=NC3C=CN12)C=5C=CC(=CC5)C6(N)CCC6
- Synonyms:
- 1,2,4-Triazolo[3,4-f][1,6]naphthyridin-3(2H)-one, 8-[4-(1-aminocyclobutyl)phenyl]-9-phenyl-, hydrochloride (1:2)
- 8-[4-(1-Aminocyclobutyl)phenyl]-9-phenyl-1,2,4-triazolo[3,4-f][1,6]naphthyridin-3(2H)-one dihydrochloride
- MK 2206 dihydrochloride

MK-2206 2HCl
Ref: IN-DA008TI0
1g | To inquire | ||
5mg | 51.00 € | ||
10mg | 56.00 € | ||
50mg | 134.00 € | ||
100mg | 151.00 € | ||
250mg | 341.00 € |

MK-2206 dihydrochloride
Ref: TM-T1952
2mg | 35.00 € | ||
5mg | 51.00 € | ||
10mg | 70.00 € | ||
25mg | 96.00 € | ||
50mg | 144.00 € | ||
100mg | 216.00 € | ||
200mg | 354.00 € | ||
500mg | 582.00 € | ||
1mL*10mM (DMSO) | 56.00 € |

MK 2206 dihydrochloride
Ref: 3D-FA26026
25g | 16,600.00 € | ||
50g | 27,310.00 € | ||
50mg | 357.00 € | ||
100mg | 482.00 € |

MK-2206 Dihydrochloride
Controlled ProductRef: TR-M425025
1mg | 92.00 € | ||
25mg | 555.00 € | ||
50mg | 910.00 € |