
CAS 1032350-13-2
:MK 2206 dihydrochloride
Description:
MK 2206 dihydrochloride is a small molecule inhibitor that primarily targets the protein kinase AKT, which plays a crucial role in various cellular processes, including metabolism, proliferation, and survival. This compound is often studied in the context of cancer research due to its potential to inhibit tumor growth and enhance the efficacy of other therapeutic agents. MK 2206 dihydrochloride is characterized by its solubility in water, which facilitates its use in biological assays. The compound typically exhibits a moderate to high affinity for AKT, leading to the disruption of downstream signaling pathways associated with cell survival and growth. Its chemical structure includes a specific arrangement of functional groups that contribute to its biological activity. In preclinical studies, MK 2206 has shown promise in various cancer models, making it a candidate for further investigation in clinical settings. However, like many investigational drugs, its safety and efficacy in humans are subjects of ongoing research.
Formula:C25H21N5O·2ClH
InChI:InChI=1S/C25H21N5O.2ClH/c26-25(12-4-13-25)18-9-7-17(8-10-18)22-19(16-5-2-1-3-6-16)15-20-21(27-22)11-14-30-23(20)28-29-24(30)31;;/h1-3,5-11,14-15H,4,12-13,26H2,(H,29,31);2*1H
InChI key:InChIKey=HWUHTJIKQZZBRA-UHFFFAOYSA-N
SMILES:O=C1N2C(C=3C(=NC(=C(C3)C4=CC=CC=C4)C5=CC=C(C=C5)C6(N)CCC6)C=C2)=NN1.Cl
Synonyms:- 1,2,4-Triazolo[3,4-f][1,6]naphthyridin-3(2H)-one, 8-[4-(1-aminocyclobutyl)phenyl]-9-phenyl-, hydrochloride (1:2)
- 8-[4-(1-Aminocyclobutyl)phenyl]-9-phenyl-1,2,4-triazolo[3,4-f][1,6]naphthyridin-3(2H)-one dihydrochloride
- MK 2206 dihydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
MK-2206 2HCl
CAS:8-(4-(1-Aminocyclobutyl)phenyl)-9-phenyl-[1,2,4]triazolo[3,4-f][1,6]naphthyridin-3(2H)-one dihydrochlorideFormula:C25H23Cl2N5OPurity:98%Molecular weight:480.39MK-2206 dihydrochloride
CAS:MK-2206 dihydrochlorideFormula:C25H23Cl2N5OPurity:≥98%Molecular weight:480.39MK-2206 dihydrochloride
CAS:MK-2206 dihydrochloride (MK-2206 2HCl) is a variant Akt inhibitor that inhibits Akt1, Akt2, and Akt3 (IC50=8/12/65 nM) with orally active, highly potent andFormula:C25H23Cl2N5OPurity:99.22% - 99.94%Color and Shape:SolidMolecular weight:480.39Ref: TM-T1952
2mg34.00€5mg49.00€1mL*10mM (DMSO)52.00€10mg66.00€25mg90.00€50mg137.00€100mg205.00€200mg334.00€500mg552.00€MK 2206 dihydrochloride
CAS:MK 2206 is an allosteric inhibitor acting on the protein kinase B (AKT) signaling pathway. MK 2206 acts as an inhibitor in a non-ATP competitive way. MK 2206 has been investigated for clinical use against various types of cancer in which drug resistance is encountered.Formula:C25H23Cl2N5OPurity:Min. 98 Area-%Color and Shape:Off-White To Yellow SolidMolecular weight:480.39 g/molMK-2206 Dihydrochloride
CAS:Controlled ProductApplications AZD 6244 and MK 2206 are targeted small-molecule drugs that inhibit MEK and AKT responses. The combination of AZD6244 and MK2206 has a significant synergistic effect on tumor growth in vitro and in vivo and leads to increased survival rates in mice bearing highly aggressive human lung tumors. Antitumor agents. Potent AKT inhibitor.
References Yeh, T., et al.: Clin. Cancer Res., 13, 1576 (2007), Meng, J., et al.: Cancer Biol. Ther., 8, 2073 (2009),Formula:C25H21N5O·2ClHColor and Shape:NeatMolecular weight:480.39Ref: 10-F957728
Discontinued product







