CAS 103238-57-9
:Cefempidone
Description:
Cefempidone is a synthetic antibiotic belonging to the cephalosporin class, which is characterized by its beta-lactam structure. It exhibits broad-spectrum antibacterial activity, particularly against Gram-positive and some Gram-negative bacteria, making it useful in treating various bacterial infections. Cefempidone is known for its stability against certain beta-lactamases, enzymes produced by bacteria that can inactivate many antibiotics. This stability enhances its effectiveness in clinical settings, especially for infections caused by resistant strains. The compound is typically administered via injection and is metabolized in the body, with its pharmacokinetics influenced by factors such as dosage and route of administration. Common side effects may include gastrointestinal disturbances, allergic reactions, and potential impacts on renal function. As with other antibiotics, appropriate use is crucial to minimize the risk of developing antibiotic resistance. Overall, cefempidone represents a valuable option in the arsenal of antimicrobial therapies, particularly in the context of increasing antibiotic resistance.
Formula:C22H21N7O6S2
InChI:InChI=1/C22H21N7O6S2/c23-22-25-8-13(37-22)14(27-35-12-4-5-24-17(12)30)18(31)26-15-19(32)29-16(21(33)34)11(10-36-20(15)29)9-28-6-2-1-3-7-28/h1-3,6-8,12,15,20H,4-5,9-10H2,(H4-,23,24,25,26,27,30,31,33,34)/t12?,15-,20-/m0/s1
SMILES:c1cc[n+](cc1)CC1=C(C(=O)[O-])N2C(=O)[C@@H]([C@@H]2SC1)NC(=O)C(=NOC1CCN=C1O)c1c[nH]c(=N)s1
Synonyms:- Cefempidone [INN:BAN]
- 1-(((6R,7R)-7-(2-(2-Amino-5-thiazolyl)glyoxylamido)-2-carboxy-8-oxo-5-thia-1-azabicyclo(4.2.0)oct-2-en-3-yl)methyl)pyridinium hydroxide, inner salt, 7(sup 2)-(E)-(O-(2-oxo-3-pyrrolidinyl)oxime)
- Gr 50692
- Unii-3Yuz4494Bq
- 1-(((6R,7R)-7-(2-(2-Amino-5-thiazolyl)glyoxylamido)-2-carboxy-8-oxo-5-thia-1-azacicyclo(4.2.0)oct-2-en-3-yl)methyl)pyridinium hydroxide, inner salt, 7,2-(E)-(o-(2-oxo-3-pyrrolidinyl)oxime)
- (6R,7R)-7-{[(2E)-2-(2-amino-1,3-thiazol-5-yl)-2-{[(2-oxopyrrolidin-3-yl)oxy]imino}acetyl]amino}-8-oxo-3-(pyridinium-1-ylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate
- (6S,7S)-7-{[(2Z)-2-(2-amino-1,3-thiazol-5-yl)-2-{[(2-oxopyrrolidin-3-yl)oxy]imino}acetyl]amino}-8-oxo-3-(pyridinium-1-ylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Cefempidone
CAS:Cefempidone (GR 50692) is a third-generation cephalosporin antibiotic. It exhibits antibacterial activity by inhibiting penicillin-binding proteins involved in the synthesis of bacterial cell walls.Formula:C22H21N7O6S2Color and Shape:SolidMolecular weight:543.58

