CAS 1032754-93-0: (S)-1-[4-[[2-(2-Aminopyrimidin-5-yl)-7-methyl-4-(morpholin-4-yl)thieno[3,2-d]pyrimidin-6-yl]methyl]piperazin-1-yl]-2-hydroxypropan-1-one
Description:The chemical substance known as (S)-1-[4-[[2-(2-Aminopyrimidin-5-yl)-7-methyl-4-(morpholin-4-yl)thieno[3,2-d]pyrimidin-6-yl]methyl]piperazin-1-yl]-2-hydroxypropan-1-one, with the CAS number 1032754-93-0, is a complex organic compound characterized by its multi-cyclic structure and various functional groups. It features a thieno[3,2-d]pyrimidine core, which is known for its biological activity, particularly in medicinal chemistry. The presence of a piperazine ring contributes to its potential pharmacological properties, while the amino and hydroxyl groups may enhance its solubility and reactivity. This compound is likely to exhibit specific stereochemistry, as indicated by the (S) configuration, which can influence its interaction with biological targets. Such compounds are often investigated for their potential therapeutic applications, including roles in treating various diseases. Overall, the intricate structure of this substance suggests a significant potential for bioactivity, warranting further research into its properties and applications in drug development.
Formula:C23H30N8O3S
InChI:InChI=1S/C23H30N8O3S/c1-14-17(13-29-3-5-31(6-4-29)22(33)15(2)32)35-19-18(14)27-20(16-11-25-23(24)26-12-16)28-21(19)30-7-9-34-10-8-30/h11-12,15,32H,3-10,13H2,1-2H3,(H2,24,25,26)/t15-/m0/s1
- Synonyms:
- Gdc-0980
- Gne 390
- (S)-1-(4-((2-(2-aMinopyriMidin-5-yl)-7-Methyl-4-Morpholinothieno[3,2-d]pyriMidin-6-yl)Methyl)piperazin-1-yl)-2-hydroxypropan-1-one
- Gdc-0980 (Rg7422)
- Apitolisib
- (2S)-1-(4-{[2-(2-Amino-5-pyrimidinyl)-7-methyl-4-(4-morpholinyl)thieno[3,2-d]pyrimidin-6-yl]methyl}-1-piperazinyl)-2-hydroxy-1-propanone