CAS 10329-98-3
:1-Naphthalenyl 2-(acetylamino)-2-deoxy-β-D-glucopyranoside
Description:
1-Naphthalenyl 2-(acetylamino)-2-deoxy-β-D-glucopyranoside, with the CAS number 10329-98-3, is a glycoside compound characterized by the presence of a naphthalene moiety and an acetylamino group attached to a deoxy sugar, specifically β-D-glucopyranoside. This compound typically exhibits properties associated with both aromatic and carbohydrate structures, including potential solubility in organic solvents and moderate solubility in water due to the hydrophilic sugar component. The acetylamino group may impart specific reactivity, making it a candidate for various chemical transformations. Its structure suggests potential biological activity, which could be explored in pharmacological contexts, particularly in relation to its interactions with biological macromolecules. The compound may also exhibit fluorescence due to the naphthalene unit, which can be advantageous in analytical applications. Overall, its unique combination of functional groups positions it as a compound of interest in both synthetic chemistry and biochemistry.
Formula:C18H21NO6
InChI:InChI=1S/C18H21NO6/c1-10(21)19-15-17(23)16(22)14(9-20)25-18(15)24-13-8-4-6-11-5-2-3-7-12(11)13/h2-8,14-18,20,22-23H,9H2,1H3,(H,19,21)/t14-,15-,16-,17-,18-/m1/s1
InChI key:InChIKey=QJRYPNZYBXWKEV-DUQPFJRNSA-N
SMILES:O([C@H]1[C@H](NC(C)=O)[C@@H](O)[C@H](O)[C@@H](CO)O1)C=2C3=C(C=CC2)C=CC=C3
Synonyms:- 1-Naphthalenyl 2-(acetylamino)-2-deoxy-β-<span class="text-smallcaps">D</span>-glucopyranoside
- 1-Naphthyl 2-acetamido-2-deoxy-beta-D-glucopyranoside
- 1-Naphthyl 2-acetamido-2-deoxy-β-<span class="text-smallcaps">D</span>-glucopyranoside
- Glucopyranoside, 1-naphthyl 2-acetamido-2-deoxy-, β-<span class="text-smallcaps">D</span>-
- naphthalen-1-yl 2-(acetylamino)-2-deoxy-beta-D-glucopyranoside
- β-<span class="text-smallcaps">D</span>-Glucopyranoside, 1-naphthalenyl 2-(acetylamino)-2-deoxy-
- Glucopyranoside, 1-naphthyl 2-acetamido-2-deoxy-, β-D-
- 1-Naphthalenyl 2-(acetylamino)-2-deoxy-β-D-glucopyranoside
- β-D-Glucopyranoside, 1-naphthalenyl 2-(acetylamino)-2-deoxy-
- 1-Naphthyl 2-acetamido-2-deoxy-β-D-glucopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1-Naphthyl N-acetyl-β-D-glucosaminide
CAS:1-Naphthyl N-acetyl-β-D-glucosaminideFormula:C18H21NO6Purity:By hplc: >98% (Typical Value in Batch COA)Color and Shape:White to off white Solid-PowderMolecular weight:347.362441-Naphthyl 2-acetamido-2-deoxy-b-D-glucopyranoside
CAS:Formula:C18H21NO6Purity:≥ 97%Color and Shape:White powderMolecular weight:347.401-Naphthyl 2-acetamido-2-deoxy-b-D-glucopyranoside
CAS:1-Naphthyl 2-acetamido-2-deoxy-b-D-glucopyranoside is a chromogenic substrate commonly used to assay the activity of enzymes that cleave N-acetyl-beta-D-glucosaminide, such as beta-N-acetylglucosaminidase. Upon cleavage by the enzyme of interest, the substrate releases a yellow-colored 1-naphthylamine, which can be measured spectrophotometrically. This substrate is widely used in biomedical research and drug discovery for studying lysosomal storage disorders, bacterial infections, and neurological diseases.
Purity:Min. 95%Molecular weight:347.36 g/mol



