CAS 10330-59-3
:3-methyl-1-(pyridin-2-yl)butan-2-one
Description:
3-Methyl-1-(pyridin-2-yl)butan-2-one, with the CAS number 10330-59-3, is an organic compound that belongs to the class of ketones. It features a butanone backbone with a methyl group and a pyridine ring substituent, contributing to its unique chemical properties. This compound is characterized by its relatively low molecular weight and moderate polarity, which influence its solubility in various organic solvents. The presence of the pyridine ring imparts basicity and potential reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and condensation reactions. Additionally, the compound may exhibit interesting biological activities, which can be explored for potential applications in pharmaceuticals or agrochemicals. Its structural features suggest that it may participate in hydrogen bonding, affecting its boiling and melting points. Overall, 3-methyl-1-(pyridin-2-yl)butan-2-one is a versatile compound with applications in organic synthesis and potential implications in medicinal chemistry.
Formula:C10H13NO
InChI:InChI=1/C10H13NO/c1-8(2)10(12)7-9-5-3-4-6-11-9/h3-6,8H,7H2,1-2H3
SMILES:CC(C)C(=O)Cc1ccccn1
Synonyms:- 2-Butanone, 3-Methyl-1-(2-Pyridinyl)-
- 3-Methyl-1-(pyridin-2-yl)butan-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
3-Methyl-1-(2-pyridinyl)-2-butanone
CAS:3-Methyl-1-(2-pyridinyl)-2-butanoneFormula:C10H13NOMolecular weight:163.22


