
CAS 1033225-44-3
:N-(2,6-Difluorophenyl)-1,2-benzenediamine
Description:
N-(2,6-Difluorophenyl)-1,2-benzenediamine is an organic compound characterized by its aromatic structure, which includes two benzene rings and an amine functional group. The presence of the difluorophenyl group introduces fluorine substituents that can significantly influence the compound's chemical properties, such as its reactivity and solubility. This compound is likely to exhibit properties typical of amines, including basicity and the ability to form hydrogen bonds. Its molecular structure suggests potential applications in pharmaceuticals or as a building block in organic synthesis, particularly in the development of dyes or agrochemicals. The fluorine atoms may enhance lipophilicity and metabolic stability, making it a candidate for drug development. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the fluorine substituents, which can affect its interaction with biological targets. Safety and handling precautions should be observed, as with many amines, due to potential toxicity and reactivity.
Formula:C12H10F2N2
InChI:InChI=1S/C12H10F2N2/c13-8-4-3-5-9(14)12(8)16-11-7-2-1-6-10(11)15/h1-7,16H,15H2
InChI key:UZIWWFQMWQTKMR-UHFFFAOYSA-N
SMILES:C1=CC=C(C(=C1)N)NC2=C(C=CC=C2F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2,6-Difluoro-2'-aminodiphenylamine
CAS:2,6-Difluoro-2'-aminodiphenylamine
Molecular weight:220.21801g/mol


