CymitQuimica logo

CAS 1033781-20-2

:

Benzenepropanoic acid, 3-[(3E)-1-[[(4-bromophenyl)methoxy]imino]ethyl]-α-ethoxy-, (αR)-

Description:
Benzenepropanoic acid, 3-[(3E)-1-[[(4-bromophenyl)methoxy]imino]ethyl]-α-ethoxy-, (αR)-, is a chemical compound characterized by its complex structure, which includes a benzene ring, a propanoic acid moiety, and an ethoxy group. The presence of a bromophenyl substituent and a methoxyimino group contributes to its unique reactivity and potential biological activity. This compound is likely to exhibit properties typical of both aromatic and aliphatic compounds, including stability under standard conditions and potential solubility in organic solvents. The specific stereochemistry indicated by the (αR) designation suggests that it may exhibit chiral properties, which can influence its interaction with biological systems. Additionally, the presence of functional groups such as the carboxylic acid and the imino group may impart acidic and basic characteristics, respectively, affecting its behavior in various chemical environments. Overall, this compound may have applications in pharmaceuticals or agrochemicals, although further studies would be necessary to fully elucidate its properties and potential uses.
Formula:C20H22BrNO4
InChI:InChI=1S/C20H22BrNO4/c1-3-25-19(20(23)24)12-16-5-4-6-17(11-16)14(2)22-26-13-15-7-9-18(21)10-8-15/h4-11,19H,3,12-13H2,1-2H3,(H,23,24)/b22-14+/t19-/m1/s1
InChI key:GWSVRVKPZVYTCS-VZMFNRANSA-N
SMILES:CCO[C@H](CC1=CC(=CC=C1)/C(=N/OCC2=CC=C(C=C2)Br)/C)C(=O)O
Synonyms:
  • Benzenepropanoic acid, 3-[(3E)-1-[[(4-bromophenyl)methoxy]imino]ethyl]-α-ethoxy-, (αR)-
Found 3 products.