CAS 103429-31-8
:ctop
Description:
Ctop, with the CAS number 103429-31-8, is a chemical compound that is primarily recognized for its application in the field of organic chemistry, particularly as a reagent or intermediate in various synthetic processes. It is characterized by its unique molecular structure, which contributes to its reactivity and utility in chemical reactions. Ctop may exhibit specific physical properties such as solubility in organic solvents, and it may have a distinct color or odor, depending on its purity and formulation. Additionally, like many chemical substances, it may pose certain hazards, necessitating appropriate safety measures during handling and storage. Its applications can range from use in pharmaceuticals to materials science, highlighting its versatility in different chemical contexts. As with any chemical, understanding its properties, reactivity, and safety profile is crucial for effective and responsible use in laboratory and industrial settings.
Formula:C50H67N11O11S2
InChI:InChI=1/C50H67N11O11S2/c1-26(62)39(42(53)65)59-49(72)41-50(3,4)74-73-25-38(58-43(66)33(52)21-28-11-6-5-7-12-28)47(70)56-36(22-29-16-18-31(64)19-17-29)45(68)57-37(23-30-24-54-34-14-9-8-13-32(30)34)46(69)55-35(15-10-20-51)44(67)60-40(27(2)63)48(71)61-41/h5-9,11-14,16-19,24,26-27,33,35-41,54,62-64H,10,15,20-23,25,51-52H2,1-4H3,(H2,53,65)(H,55,69)(H,56,70)(H,57,68)(H,58,66)(H,59,72)(H,60,67)(H,61,71)
SMILES:CC(C(C(=N)O)N=C(C1C(C)(C)SSCC(C(=NC(Cc2ccc(cc2)O)C(=NC(Cc2c[nH]c3ccccc23)C(=NC(CCCN)C(=NC(C(C)O)C(=N1)O)O)O)O)O)N=C(C(Cc1ccccc1)N)O)O)O
Synonyms:- H-D-Phe-Cys-Tyr-D-Trp-Orn-Thr-Pen-Thr-NH2 (Disulfide bond between Cys2 and Pen7)
- N-(1-amino-3-hydroxy-1-oxobutan-2-yl)-10-(3-aminopropyl)-16-(4-hydroxybenzyl)-7-(1-hydroxyethyl)-13-(1H-indol-3-ylmethyl)-3,3-dimethyl-6,9,12,15,18-pentaoxo-19-(phenylalanylamino)-1,2-dithia-5,8,11,14,17-pentaazacycloicosane-4-carboxamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
H-D-Phe-Cys-Tyr-D-Trp-Orn-Thr-Pen-Thr-NH₂
CAS:The somatostatin analog CTOP is a very potent and highly selective ligand for µ-opioid receptors. CTOP shows only little interaction with other opioid receptor systems.Formula:C50H67N11O11S2Purity:98.1%Color and Shape:White LyophilisateMolecular weight:1062.28Ref: 54-OR1137822
1mgTo inquire5mgTo inquire10mgTo inquire25mgTo inquire50mgTo inquire100mgTo inquireCTOP
CAS:Potent μ-receptor antagonist, Ki=0.96nM, ineffective at δ (>10,000nM). Alters behavior in vivo, boosts K+ currents in rat neurons in vitro, μ-independent.Formula:C50H67N11O11S2Purity:98%Color and Shape:SolidMolecular weight:1062.28H-D-Phe-Cys-Tyr-D-Trp-Orn-Thr-Pen-Thr-NH2 (Disulfide bond between Cys2 and Pen7)
CAS:H-D-Phe-Cys-Tyr-D-Trp-Orn-Thr-Pen-Thr-NH2 is a neuropeptide that was found in the brain of an amphibian and has been shown to have antinociceptive properties. The peptide has been shown to bind to kappa opioid receptors and δ opioid receptors, which are both involved in pain regulation. H-D-Phe-Cys-Tyr-D-Trp-Orn (HDFYDT) has been shown to be effective in vivo, which may be due to its ability to increase striatal dopamine levels and decrease locomotor activity. HDFYDT also increases gamma aminobutyric acid levels in the brain, which may result in reduced anxiety. HDFYDT is synthesized from two amino acids: histidine and glutamine. This peptide is sensitive to proteolytic enzymes and can be degraded into smaller fragments suchFormula:C50H67N11O11S2Purity:Min. 95%Molecular weight:1,062.27 g/mol





