CAS 103438-84-2
:2-Fluoro-5-hydroxybenzaldehyde
Description:
2-Fluoro-5-hydroxybenzaldehyde is an organic compound characterized by the presence of a fluorine atom, a hydroxyl group, and an aldehyde functional group attached to a benzene ring. The fluorine atom is located at the second position, while the hydroxyl group is at the fifth position of the aromatic ring, contributing to the compound's reactivity and potential applications in various chemical reactions. This compound typically exhibits properties such as being a colorless to pale yellow liquid or solid, depending on its state at room temperature. It is soluble in organic solvents and may have limited solubility in water due to the hydrophobic nature of the benzene ring. The presence of the hydroxyl group can impart hydrogen bonding capabilities, influencing its boiling and melting points. 2-Fluoro-5-hydroxybenzaldehyde is of interest in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals, due to its potential as an intermediate in various chemical syntheses. Safety precautions should be observed when handling this compound, as it may pose health risks.
Formula:C7H5FO2
InChI:InChI=1/C7H5FO2/c8-7-2-1-6(10)3-5(7)4-9/h1-4,10H
SMILES:c1cc(c(cc1O)C=O)F
Synonyms:- Benzaldehyde, 2-Fluoro-5-Hydroxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Fluoro-5-hydroxybenzaldehyde
CAS:2-Fluoro-5-hydroxybenzaldehydeFormula:C7H5FO2Purity:98%Molecular weight:140.112-Fluoro-5-hydroxybenzaldehyde
CAS:Formula:C7H5FO2Purity:97%Color and Shape:SolidMolecular weight:140.11182-Fluoro-5-hydroxybenzaldehyde
CAS:2-Fluoro-5-hydroxybenzaldehydeFormula:C7H5FO2Purity:98%Color and Shape:SolidMolecular weight:140.11182-Fluoro-5-hydroxybenzaldehyde
CAS:Formula:C7H5FO2Purity:95%Color and Shape:SolidMolecular weight:140.1132-fluoro-5-hydroxybenzaldehyde
CAS:2-Fluoro-5-hydroxybenzaldehyde (2FHBA) is an olefinic compound that is synthesized from 2,5-dihydroxybenzaldehyde by reductive amination with formaldehyde. The configuration of 2FHBA is dependent on the dihedral angle between the two olefinic groups. Liquid chromatography has been used to analyze the metabolic pathway of 2FHBA in rats and humans. This study showed that tyramine and aligned are metabolites of 2FHBA in rats, while crystallized and emission are metabolites in humans. The positron emission studies also showed that 2FHBA was metabolized by erythrocytes in vitro to produce positron emission.Formula:C7H5FO2Purity:Min. 95%Molecular weight:140.11 g/mol




