CAS 103438-85-3
:4-fluoro-3-hydroxybenzaldehyde
Description:
4-Fluoro-3-hydroxybenzaldehyde, with the CAS number 103438-85-3, is an organic compound characterized by the presence of a fluorine atom, a hydroxyl group, and an aldehyde functional group attached to a benzene ring. This compound typically appears as a pale yellow to light brown solid or liquid, depending on its purity and specific conditions. It is known for its aromatic properties due to the benzene ring, which contributes to its reactivity and potential applications in organic synthesis. The hydroxyl group imparts polarity, enhancing its solubility in polar solvents, while the aldehyde group can participate in various chemical reactions, such as nucleophilic addition and condensation reactions. The presence of the fluorine atom can influence the compound's electronic properties, potentially affecting its reactivity and interaction with biological systems. 4-Fluoro-3-hydroxybenzaldehyde may be utilized in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals, making it a compound of interest in both academic and industrial research.
Formula:C7H5FO2
InChI:InChI=1/C7H5FO2/c8-6-2-1-5(4-9)3-7(6)10/h1-4,10H
SMILES:c1cc(c(cc1C=O)O)F
Synonyms:- Benzaldehyde, 4-Fluoro-3-Hydroxy-
- 3-Fluoro-4-hydroxybenzaldehyde
- 4-fluoro-3-hydroxy-benzaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Fluoro-3-hydroxybenzaldehyde
CAS:Formula:C7H5FO2Purity:98%Color and Shape:SolidMolecular weight:140.11184-Fluoro-3-hydroxybenzaldehyde
CAS:4-Fluoro-3-hydroxybenzaldehydeFormula:C7H5FO2Purity:98%Color and Shape:SolidMolecular weight:140.11184-Fluoro-3-hydroxybenzaldehyde
CAS:4-Fluoro-3-hydroxybenzaldehyde is a fluorescent chemical that belongs to the group of alcohols. It has been shown to have the following properties: an excitation wavelength of 285 nm, a fluorescence wavelength of 350 nm, and a quantum yield of 0.004%. The solvent effect on 4-fluoro-3-hydroxybenzaldehyde's fluorescence intensity is approximately linear with concentration, but the fluorescence profile is dependent on the polarity of the solvent. The phenyl group of 4-fluoro-3-hydroxybenzaldehyde causes it to be more polarizable than other molecules in its class. The kinetic rate constants for 4-fluoro-3-hydoxybenzaldehyde were found by measuring the decay rates of its fluorescence emission as a function of time.Formula:C7H5FO2Purity:Min. 95%Color and Shape:PowderMolecular weight:140.11 g/mol4-Fluoro-3-hydroxybenzaldehyde
CAS:Formula:C7H5FO2Purity:95%Color and Shape:SolidMolecular weight:140.1134-Fluoro-3-hydroxybenzaldehyde
CAS:4-Fluoro-3-hydroxybenzaldehydeFormula:C7H5FO2Purity:98%Molecular weight:140.11




